| Time |
Nick |
Message |
| 00:00 |
berome |
?Am I understandable ? |
| 00:00 |
|
moltenbot joined #minetest |
| 00:01 |
marktraceur |
berome: More than understandable, very well-spoken I'd say |
| 00:01 |
|
moltenbot joined #minetest |
| 00:01 |
berome |
cool, good news ! |
| 00:01 |
iqualfragile |
!help |
| 00:01 |
moltenbot |
Try !up <hostname.org> !ping <hostname.org> [<port>] !date |
| 00:02 |
marktraceur |
iqualfragile: Why. |
| 00:02 |
iqualfragile |
why what? |
| 00:02 |
marktraceur |
iqualfragile: Why did you bring ANOTHER BOT into this channel? |
| 00:02 |
iqualfragile |
are you referring to iglooboot? |
| 00:02 |
iqualfragile |
or to minetestbot? |
| 00:03 |
OldCoder |
How many bots are there? |
| 00:03 |
iqualfragile |
one to two |
| 00:03 |
iqualfragile |
iglooboot was just me and i answered like a bot would |
| 00:04 |
iqualfragile |
marktraceur |
| 00:04 |
iqualfragile |
well, i want my bot to be usefull, so what features should it have? |
| 00:05 |
|
sfan5[iPod] joined #minetest |
| 00:05 |
OldCoder |
iqualfragile, absence |
| 00:05 |
OldCoder |
That would be a good one |
| 00:05 |
OldCoder |
:-) |
| 00:05 |
* OldCoder |
sighs |
| 00:05 |
OldCoder |
Never mind. Sorry. |
| 00:05 |
berome |
lol |
| 00:05 |
OldCoder |
But bots apparently mean dissension |
| 00:06 |
iqualfragile |
dissension? |
| 00:06 |
OldCoder |
I probably misspelled that |
| 00:06 |
iqualfragile |
i just did not know the word, looked it up |
| 00:07 |
berome |
bots MUST talk when "silence" is here for "long" time, imo |
| 00:07 |
marktraceur |
iqualfragile: There are already multiple bots vying for attention here. Please don't add to that. |
| 00:07 |
iqualfragile |
can you name some? |
| 00:07 |
marktraceur |
iqualfragile: Since MinetestBot was sfan5's creation, I figure we should give it priority |
| 00:08 |
iqualfragile |
well, he saw me creating moltenbot yesterday evening |
| 00:08 |
moltenbot |
Hi, iqualfragile |
| 00:08 |
iqualfragile |
and then used some python-framework to make one, too |
| 00:10 |
iqualfragile |
so: wich features would be nice for a bot in a minetest-channel? |
| 00:10 |
marktraceur |
iqualfragile: I agree with absence. |
| 00:10 |
iqualfragile |
well, besides absence |
| 00:11 |
marktraceur |
iqualfragile: Barring that, centralization. Please talk to sfan5 about working on his bot, rather than adding a new one. |
| 00:11 |
marktraceur |
iqualfragile: Also, testing it somewhere else is better. |
| 00:11 |
iqualfragile |
again: i was here first |
| 00:11 |
iqualfragile |
that was quite a low-quality-translation |
| 00:12 |
iqualfragile |
i did not add a new one |
| 00:12 |
iqualfragile |
sfan5 added a new one |
| 00:12 |
Muadtralk |
is there any reason for a minetest bot when there are so many people on at all hours willing to help? |
| 00:13 |
Muadtralk |
or at least try to help |
| 00:14 |
iqualfragile |
i guess !up can be usefull |
| 00:14 |
marktraceur |
Muadtralk: It helps us type less |
| 00:14 |
iqualfragile |
especialy for people behind firewalls or strange stuffs |
| 00:14 |
marktraceur |
iqualfragile: Regardless of who came first, he's an op and (to my knowledge) you aren't |
| 00:14 |
iqualfragile |
-.- |
| 00:15 |
iqualfragile |
my bot is way cooler |
| 00:15 |
iqualfragile |
its written in bash |
| 00:15 |
* marktraceur |
hasn't seen evidence of that |
| 00:15 |
marktraceur |
Yeah, you're not helping your case |
| 00:15 |
Muadtralk |
neither of your bots are cool |
| 00:15 |
iqualfragile |
including the network |
| 00:19 |
iqualfragile |
the bots are just here for testing anyways |
| 00:20 |
iqualfragile |
but if we decide to keep one, what features would you expect? |
| 00:20 |
OldCoder |
iqualfragile, I've got one of my own... |
| 00:21 |
marktraceur |
iqualfragile: I would expect the ability to let people add, remove, and alias keys on their own. |
| 00:21 |
marktraceur |
iqualfragile: See e.g. wikibots. |
| 00:21 |
OldCoder |
She does google, greetings, time in foreign lands, math calculations, and knows 70 pages of jokes. |
| 00:21 |
OldCoder |
I'll add the server support stuff and maybe she can gateway IRC to MT chat |
| 00:22 |
* marktraceur |
thinks it's nearly time to /part again |
| 00:22 |
iqualfragile |
as this channel is out of operators for quite some time i thought about a vote-kick feature |
| 00:22 |
OldCoder |
What is /part for the faint of heart? Is /part black art? |
| 00:22 |
OldCoder |
iqualfragile, What? |
| 00:22 |
OldCoder |
We have ops now |
| 00:22 |
iqualfragile |
yeah, but not allways |
| 00:22 |
OldCoder |
They should encourage mediate where possible |
| 00:22 |
OldCoder |
Heh |
| 00:23 |
OldCoder |
I am not always paying attention but I am sometimes here 16 hours a day |
| 00:23 |
iqualfragile |
i know |
| 00:23 |
iqualfragile |
but that one would help your relax |
| 00:23 |
OldCoder |
Relax heh |
| 00:23 |
OldCoder |
Not likely |
| 00:23 |
OldCoder |
But thanks |
| 00:23 |
marktraceur |
OldCoder: /part is for leaving channels |
| 00:23 |
OldCoder |
Why? |
| 00:23 |
OldCoder |
Don't leave |
| 00:23 |
OldCoder |
We'd grieve |
| 00:24 |
OldCoder |
:-) |
| 00:24 |
marktraceur |
OldCoder: If there are going to be upwards of three bots in this channel, it would be stupid to stay. |
| 00:24 |
OldCoder |
marktraceur, there won't be |
| 00:24 |
iqualfragile |
if someone is offended by someone else he says !votekick marktraceur |
| 00:24 |
OldCoder |
I may subsume the others into mine |
| 00:24 |
OldCoder |
iqualfragile, use a fake name please for your example |
| 00:24 |
marktraceur |
*especially* if they all imitate the same ridiculous features like Twitter, Google, etc. |
| 00:24 |
OldCoder |
Yep |
| 00:24 |
OldCoder |
Mine are more cool |
| 00:24 |
iqualfragile |
and then the people in the channel can say !votekick yes or !votekick no |
| 00:25 |
OldCoder |
iqualfragile, we understand the notion |
| 00:25 |
OldCoder |
It is not a magic potion |
| 00:25 |
OldCoder |
It is clear |
| 00:25 |
OldCoder |
No beer |
| 00:25 |
marktraceur |
OldCoder: Google, math, and jokes all seem useless to me. |
| 00:25 |
NakedFury |
maybe add a show youtube video names when someone posts a link? |
| 00:25 |
OldCoder |
is needed to understand it |
| 00:25 |
OldCoder |
NakedFury, Yep |
| 00:25 |
OldCoder |
marktraceur, I have more than that |
| 00:25 |
OldCoder |
And I put 70 pages of humor into her |
| 00:25 |
OldCoder |
She is quite popular in some circles |
| 00:25 |
iqualfragile |
and if at least some percentage of the channel-inhabitants vote and more then 50% vote for kick he gets kicked |
| 00:25 |
OldCoder |
iqualfragile, We get it |
| 00:26 |
NakedFury |
and like that sfanbot a minetest wiki command will be usefull |
| 00:26 |
marktraceur |
Well, time in other places and greetings both seem like things anyone can do without a bot. |
| 00:26 |
OldCoder |
marktraceur, time is quite useful for me. I deal with folks around the globe. |
| 00:26 |
iqualfragile |
nah, the time in other places is usefull |
| 00:26 |
OldCoder |
greetings agreed |
| 00:26 |
Muadtralk |
hmmm |
| 00:26 |
iqualfragile |
but googling? |
| 00:26 |
marktraceur |
OldCoder: And for that purpose, you learn to use UTC offsets and basic arithmetic. |
| 00:26 |
iqualfragile |
and an in-chat-wiki does not seem to be a great ide |
| 00:26 |
OldCoder |
marktraceur, I am in about 75 channels these days |
| 00:27 |
OldCoder |
Counting PM. Kind of busy as you are too! |
| 00:27 |
OldCoder |
You know time is valuable |
| 00:27 |
marktraceur |
OldCoder: If it takes you time to add 7 hours to the current time, you maybe shouldn't be in 70+ channels |
| 00:27 |
OldCoder |
marktraceur, thank you |
| 00:28 |
OldCoder |
This never would have occurred to me |
| 00:28 |
OldCoder |
:p |
| 00:28 |
OldCoder |
marktraceur, I don't always remember who is in what timezone |
| 00:28 |
OldCoder |
I like doing !time cairo etc. |
| 00:28 |
OldCoder |
It's fast |
| 00:29 |
OldCoder |
I talk to dozens of people. Wish to know when they are. As well as where. |
| 00:30 |
marktraceur |
OldCoder: TZ="Cairo" date |
| 00:31 |
OldCoder |
Takes longer to type |
| 00:31 |
marktraceur |
Not if you alias it |
| 00:31 |
OldCoder |
Hmm |
| 00:31 |
marktraceur |
Or write a quick bash script that will take TZ as an argument |
| 00:31 |
OldCoder |
Does TZ="Baconville, NY" date work? |
| 00:32 |
marktraceur |
Probably not so simply, but I could be wrong |
| 00:32 |
OldCoder |
I prefer simple |
| 00:32 |
* marktraceur |
sighs |
| 00:32 |
marktraceur |
Well, let me know when the timezone bot has joined. |
| 00:33 |
OldCoder |
No rush |
| 00:33 |
OldCoder |
There will be no horde of bots. The thoughts of this are distressing. Bots are nots to be crowded. |
| 00:35 |
marktraceur |
OldCoder: No, no rush at all, because the second we have a bot that can do timezones, I'm leaving, because it means that the channel has very little remaining merit |
| 00:36 |
NakedFury |
just because there is a bot doesnt mean you have to use it |
| 00:36 |
NakedFury |
and old coder can just make the commands obscure so only he knows them |
| 00:36 |
iqualfragile |
!die |
| 00:37 |
marktraceur |
It's less about the usefulness of the bot and more about the usefulness of the people who saw a need for such a thing |
| 00:37 |
|
moltenbot joined #minetest |
| 00:37 |
OldCoder |
marktraceur, you are too strict. I will make you a deal. We will add features you wish. |
| 00:37 |
OldCoder |
Is this acceptable? |
| 00:37 |
iqualfragile |
!date cairo |
| 00:37 |
moltenbot |
Sa 1. Dez 01:37:40 CET 2012 |
| 00:37 |
iqualfragile |
damn |
| 00:37 |
OldCoder |
iqualfragile, Please test elsewhere |
| 00:38 |
iqualfragile |
allright |
| 00:38 |
marktraceur |
OldCoder: I'm not enforcing anything. |
| 00:38 |
marktraceur |
OldCoder: You add whatever you'd like, and I'll react how I think I should. |
| 00:39 |
OldCoder |
marktraceur, It is a polite suggestion. She will talk about GNU/Linux. There will be a !stallman command if you like. |
| 00:39 |
NakedFury |
can the bot whisper you when you do those commands so it doesnt spam the channel? also add preventive methods from repeting use like with today |
| 00:40 |
OldCoder |
NakedFury, agreed! |
| 00:40 |
NakedFury |
so kikaz cant spam us with it |
| 00:40 |
OldCoder |
Yep |
| 00:40 |
OldCoder |
Should be time limited |
| 00:41 |
iqualfragile |
i have just added a bit of code so i can talk to it in private |
| 00:41 |
|
marktraceur left #minetest |
| 00:43 |
|
moltenbot joined #minetest |
| 00:43 |
OldCoder |
iqualfragile, that is good of you |
| 00:43 |
iqualfragile |
oldcoder: added a timezone-feature |
| 00:43 |
iqualfragile |
!date cairo |
| 00:43 |
moltenbot |
Sa 1. Dez 00:43:58 cairo 2012 |
| 00:44 |
OldCoder |
iqualfragile, now we need !stallman command or something |
| 00:44 |
iqualfragile |
what should it do |
| 00:44 |
OldCoder |
I was half joking but let me ask... |
| 00:44 |
iqualfragile |
search for prop. content in the channel? |
| 00:44 |
OldCoder |
Ah |
| 00:44 |
OldCoder |
He left |
| 00:44 |
OldCoder |
:-( |
| 00:44 |
OldCoder |
I'll ask him if he comes back |
| 00:47 |
|
Basstard1 joined #minetest |
| 00:48 |
|
anunakki joined #minetest |
| 00:49 |
iqualfragile |
i guess im gone go& sleep now, good night |
| 00:51 |
OldCoder |
anunakki, Hi! |
| 00:53 |
iqualfragile |
!die and good night everybod |
| 00:59 |
berome |
ok, good nignt guys ! glad to read you ! |
| 01:06 |
|
sebastiansam55 joined #minetest |
| 01:16 |
|
Doc22_ joined #minetest |
| 01:16 |
Doc22_ |
Hey guys |
| 01:16 |
Doc22_ |
Kick Doc22 |
| 01:16 |
Doc22_ |
i double logged |
| 01:16 |
Doc22_ |
lol |
| 01:16 |
Doc22_ |
again |
| 01:18 |
|
babyface1031 joined #minetest |
| 01:18 |
Doc22_ |
VanessaE can you give me link to version 4.4 |
| 01:18 |
Doc22_ |
and hey babyface1031 |
| 01:18 |
babyface1031 |
hey Doc22_ |
| 01:18 |
Doc22_ |
hey |
| 01:19 |
OldCoder |
babyface1031, Hi! Doc22 you 2 |
| 01:19 |
Doc22_ |
hey |
| 01:19 |
Doc22_ |
oc can yo point me to 4.4 |
| 01:19 |
babyface1031 |
hey OldCoder |
| 01:19 |
Doc22_ |
you* |
| 01:19 |
Doc22_ |
I need the download for it |
| 01:21 |
Doc22_ |
OldCoder where is download for 4.4 |
| 01:21 |
Doc22_ |
I tried google |
| 01:21 |
Doc22_ |
and main site |
| 01:22 |
NakedFury |
give me a sexc |
| 01:22 |
NakedFury |
sec |
| 01:22 |
Doc22_ |
ok |
| 01:22 |
Doc22_ |
thanks |
| 01:22 |
Doc22_ |
and are you interested in making mesecons machines |
| 01:22 |
Doc22_ |
I will host |
| 01:22 |
NakedFury |
http://sfan.sf.funpic.de/minetest-builds/c55/minetest-0.4.4-655bb52-win32.7z |
| 01:22 |
Doc22_ |
thanks |
| 01:23 |
OldCoder |
Doc22, I don't do 4.4 yet |
| 01:23 |
Doc22_ |
o |
| 01:23 |
Doc22_ |
ok |
| 01:23 |
Doc22_ |
would you do it on 4.3 |
| 01:23 |
NakedFury |
not a mesecon engineer. I mostly build in old coders server. you can play 0.4.3 on 0.4.4 |
| 01:23 |
Doc22_ |
all right |
| 01:25 |
Doc22_ |
kaeza are you interested in making mesecons machines? |
| 01:28 |
|
celeron55 joined #minetest |
| 01:40 |
NakedFury |
old coder server 30k is down I think |
| 01:45 |
OldCoder |
NakedFury, Need to omit space for me to see that |
| 01:45 |
OldCoder |
Checking now |
| 01:45 |
OldCoder |
17:23:31: ERROR[ServerThread]: ERROR: An unhandled exception occurred: Player::deSerialize(): PlayerArgsEnd not found |
| 01:45 |
OldCoder |
NakedFury, I have been getting those recently |
| 01:45 |
OldCoder |
Advice from people would be appreciated |
| 01:45 |
OldCoder |
Hold on |
| 01:45 |
OldCoder |
I'll fix it |
| 01:50 |
OldCoder |
|
| 01:50 |
NakedFury |
ok im on standby then |
| 01:50 |
OldCoder |
NakedFury, still working |
| 01:50 |
OldCoder |
See error abovfe |
| 01:50 |
OldCoder |
See error above |
| 01:51 |
NakedFury |
we need an error wiki, it would explain all errors the game can produce |
| 01:51 |
Doc22_ |
yeah |
| 01:52 |
NakedFury |
all I can see from that error is perhaps something about player |
| 01:53 |
RealBadAngel |
propably some1 changed somethin there lately |
| 01:53 |
RealBadAngel |
and commited a bug |
| 01:54 |
OldCoder |
|
| 01:54 |
OldCoder |
NakedFury, Done |
| 01:54 |
OldCoder |
NakedFury, it works now |
| 01:54 |
RealBadAngel |
in deSerialize method in player function |
| 01:54 |
OldCoder |
RealBadAngel, files are truncated |
| 01:54 |
OldCoder |
to zero on shutdown |
| 01:54 |
OldCoder |
That is what is happening |
| 01:54 |
OldCoder |
RealBadAngel, BTW glad to see you |
| 01:55 |
RealBadAngel |
u2 |
| 01:55 |
RealBadAngel |
its not about files |
| 01:55 |
RealBadAngel |
deserialize is an internal function to convert contenst to string |
| 01:56 |
RealBadAngel |
well, back actually |
| 01:56 |
RealBadAngel |
from string back to the structure |
| 01:57 |
RealBadAngel |
but error can be on both ends |
| 01:57 |
OldCoder |
Yep |
| 01:57 |
OldCoder |
But some files are going to zero length |
| 01:57 |
OldCoder |
Replacing them usually fixes the problem |
| 01:58 |
RealBadAngel |
its about players skins? |
| 02:00 |
RealBadAngel |
if a file is zeroed propably creating it, read serialize failed |
| 02:00 |
RealBadAngel |
so like i started |
| 02:00 |
RealBadAngel |
so deserialize can not proceed |
| 02:09 |
OldCoder |
Hmm |
| 02:09 |
OldCoder |
I suspect there is a problem with shutdown |
| 02:09 |
OldCoder |
That resets the files |
| 02:09 |
OldCoder |
I have already encountered this with env_meta.txt |
| 02:10 |
OldCoder |
Added a workaround for that. May build in a fix for the players as well. |
| 02:19 |
Dogzilla131 |
does a mining laser do affect to another person or player |
| 02:26 |
|
Taoki joined #minetest |
| 02:26 |
Doc22_ |
idk |
| 02:26 |
Doc22_ |
wanna play with me Dogzilla131 |
| 02:26 |
Doc22_ |
on my server |
| 02:26 |
Doc22_ |
worldedit, mesecons |
| 02:30 |
Dogzilla131 |
yeah |
| 02:30 |
|
NekoGloop joined #minetest |
| 02:35 |
Doc22_ |
ok |
| 02:35 |
Doc22_ |
ill pm u ip |
| 02:36 |
NekoGloop |
Or we can /whois Doc22_ |
| 02:36 |
Doc22_ |
lol |
| 02:36 |
Dogzilla131 |
port and adress |
| 02:36 |
Doc22_ |
i pmed it |
| 02:36 |
NekoGloop |
Webchat has a nasty habit of revealing your ip address to whoever wants it. |
| 02:48 |
NekoGloop |
Gah. Someone say something dammit. |
| 02:49 |
OldCoder |
Hi |
| 02:49 |
OldCoder |
^ Something |
| 02:49 |
OldCoder |
Quiet tonight! |
| 02:49 |
OldCoder |
NekoGloop, how are you? |
| 02:49 |
NekoGloop |
Bored. |
| 02:49 |
NekoGloop |
Hopefully the server for this FPS doesnt lag like hell now ^^" |
| 02:50 |
NekoGloop |
Earlier today i couldnt even join a game. |
| 02:56 |
OldCoder |
k |
| 03:01 |
|
ttk2 joined #minetest |
| 03:14 |
|
Doc22_ joined #minetest |
| 03:17 |
kaeza |
NekoGloop: what are you playing? |
| 03:19 |
NekoGloop |
kaeza: Shadowgun: Deadzone |
| 03:19 |
kaeza |
oh |
| 03:20 |
kaeza |
nvm |
| 03:20 |
kaeza |
I want to play some CS 1.6 |
| 03:20 |
kaeza |
but on my favs there are only bots at this hour |
| 03:36 |
|
kaeza joined #minetest |
| 03:49 |
|
Muadtralk left #minetest |
| 03:57 |
|
jordan4ibanez joined #minetest |
| 04:07 |
jordan4ibanez |
Found weird issue |
| 04:07 |
jordan4ibanez |
on_rightclick(self, clicker) |
| 04:07 |
jordan4ibanez |
which ever you put first is the only one that is used |
| 04:07 |
jordan4ibanez |
wether it be self or clicker, one or the other, it's strange |
| 04:08 |
kaeza |
night ppl |
| 04:08 |
|
kaeza left #minetest |
| 04:09 |
jordan4ibanez |
Never mind I'm just retarded |
| 04:14 |
Doc22_ |
im getting a nasty bug |
| 04:14 |
Doc22_ |
its with mesecons wire crossing |
| 04:18 |
Doc22_ |
hrmm ill try rebuilding it |
| 04:18 |
Doc22_ |
its so strange... |
| 04:18 |
Doc22_ |
something about content-ignore |
| 04:18 |
Dogzilla131 |
this is random, but who knows slender man is |
| 04:21 |
|
anunakki joined #minetest |
| 04:25 |
Doc22_ |
google him |
| 04:25 |
Doc22_ |
i think hes from a game |
| 04:25 |
Doc22_ |
lol |
| 04:27 |
jordan4ibanez |
http://www.youtube.com/watch?v=CTRb6-C-9rg |
| 04:38 |
Dogzilla131 |
i know him, im asking you'all |
| 04:55 |
jordan4ibanez |
Heyguiseguesswhat |
| 04:58 |
jordan4ibanez |
BOATS ALPHA 1 ARE ALMOST DUNNNNNNNNNN |
| 05:00 |
|
opticlove joined #minetest |
| 05:33 |
|
Calinou joined #minetest |
| 05:37 |
jordan4ibanez |
Wow making this was easier than i thought |
| 05:50 |
|
bulletrulz joined #minetest |
| 05:50 |
bulletrulz |
who wants to be in my review of minetest 0.4.4? |
| 06:22 |
|
jordan4ibanez joined #minetest |
| 06:22 |
jordan4ibanez |
lol webchat works on xbox |
| 06:29 |
|
bars joined #minetest |
| 06:37 |
OldCoder |
Good night |
| 06:37 |
bulletrulz |
night |
| 06:38 |
Calinou |
lolxbox |
| 06:40 |
* VanessaE |
peeks in |
| 06:45 |
|
TForsman joined #minetest |
| 06:53 |
Calinou |
hi |
| 06:53 |
VanessaE |
morning |
| 06:53 |
Calinou |
20 days until minetest 1.0 :D |
| 06:54 |
VanessaE |
heh |
| 06:54 |
ecube |
:O |
| 07:13 |
VanessaE |
ok, bedtime |
| 07:13 |
VanessaE |
night all. |
| 07:19 |
|
Calinou left #minetest |
| 07:19 |
|
Calinou joined #minetest |
| 07:21 |
|
Ragnar_ joined #minetest |
| 07:21 |
Ragnar_ |
hi |
| 07:22 |
Ragnar_ |
hi VanessaE |
| 07:23 |
Ragnar_ |
hi Sfan! |
| 07:40 |
sfan5 |
.sv |
| 07:40 |
MinetestBot |
sfan5: dise's server [0.4.3] | dise-minetest.no-ip.org:30000 up (84.915%) |
| 07:41 |
RealBadAngel |
.sv |
| 07:41 |
MinetestBot |
RealBadAngel: PlanetMinetest Creative Server | planetminetest.com:30000 down |
| 07:41 |
RealBadAngel |
cool |
| 07:43 |
RealBadAngel |
sfan5: can you compile this for windows? https://github.com/RealBadAngel/minetest |
| 07:47 |
|
MinetestBot joined #minetest |
| 07:54 |
|
chaplain joined #minetest |
| 08:01 |
|
chaplain joined #minetest |
| 08:06 |
Calinou |
someone's using windows |
| 08:06 |
RealBadAngel |
strange, but some folks still does ;) |
| 08:09 |
|
chaplain joined #minetest |
| 08:10 |
Calinou |
http://dl.dropbox.com/u/82342922/0.4.x-changelog.txt < changelog updated |
| 08:12 |
|
tango_ joined #minetest |
| 08:17 |
|
chaplain joined #minetest |
| 08:18 |
|
chaplain joined #minetest |
| 08:20 |
|
blaze joined #minetest |
| 08:20 |
|
Jordach joined #minetest |
| 08:22 |
* Jordach |
is getting 2mb+ on a torrent# |
| 08:23 |
Calinou |
loltorrents |
| 08:23 |
Calinou |
seems legit, what are you torrenting? :P |
| 08:24 |
Jordach |
Calinou - on occasion utorrrent suggests free album releases |
| 08:24 |
Calinou |
utorrent is adware |
| 08:24 |
Jordach |
(which the artists partner with them) |
| 08:25 |
Jordach |
Calinou - DIGAF |
| 08:25 |
Calinou |
no, but i do. |
| 08:25 |
Jordach |
lol. |
| 08:25 |
Calinou |
use ubuntu and see, you will give a fuff :> |
| 08:26 |
Jordach |
ike |
| 08:26 |
Jordach |
ikr |
| 08:26 |
Jordach |
ubuntu needs a colonoscopy |
| 08:27 |
Jordach |
(laymans terms: removing all the shit inside) |
| 08:27 |
|
chaplain joined #minetest |
| 08:31 |
* Calinou |
got his 154 comment karma back on reddit |
| 08:31 |
Calinou |
people keep hating on me whenever I talk about steam, 2 weeks ago I did a post which had -20 points |
| 08:31 |
Calinou |
:> |
| 08:32 |
Jordach |
Calinou - be fair, some of the best games are coming to linux |
| 08:34 |
|
KikaRz joined #minetest |
| 08:34 |
Jordach |
and let the flooding begin |
| 08:37 |
|
chaplain joined #minetest |
| 08:37 |
sfan5 |
I have 145 comment karma :( |
| 08:38 |
Jordach |
lolReddit |
| 08:39 |
KikaRz |
I tahre |
| 08:39 |
KikaRz |
how are yu pipolZ? |
| 08:40 |
Jordach |
huh, no freaking way! A MC GPL LICENSED TOOL! |
| 08:40 |
KikaRz |
ИФФФ |
| 08:40 |
KikaRz |
©мþ |
| 08:42 |
Calinou |
Jordach> Calinou - be fair, some of the best games are coming to linux |
| 08:42 |
Calinou |
drm'd proprieary games != best games |
| 08:43 |
|
SpeedProg joined #minetest |
| 08:45 |
|
chaplain joined #minetest |
| 09:08 |
|
chaplain joined #minetest |
| 09:10 |
|
chaplain joined #minetest |
| 09:20 |
|
Matsetes joined #minetest |
| 09:22 |
Jordach |
thomas - having irc problems? |
| 09:23 |
thomas |
not anymore |
| 09:23 |
thomas |
irssi was being an ass |
| 09:24 |
Jordach |
ah |
| 09:25 |
thomas |
it decided it didn't like joining 120 channels on connect |
| 09:25 |
thomas |
so i had to tinkier with the lag timeout. |
| 09:25 |
thomas |
tinker even |
| 09:25 |
|
Zeg9 joined #minetest |
| 09:25 |
Jordach |
<thomas> it decided it didn't like joining 120 channels on connect. 120 channels!?! |
| 09:26 |
Jordach |
oh my |
| 09:26 |
thomas |
mhmm |
| 09:29 |
|
Ragnar_ joined #minetest |
| 09:29 |
Ragnar_ |
hi |
| 09:30 |
Zeg9 |
Hi |
| 09:30 |
|
jin_xi joined #minetest |
| 09:31 |
Ragnar_ |
oh hey zeg :D |
| 09:31 |
Ragnar_ |
im making a webpage for PythonServ... |
| 09:31 |
Ragnar_ |
wanna help? |
| 09:31 |
* Jordach |
is working on another texture pack |
| 09:31 |
* Ragnar_ |
is waiting forward to it |
| 09:32 |
Ragnar_ |
zeg! |
| 09:32 |
Ragnar_ |
Zeg9: Hey you wanna help me with my webpage? |
| 09:33 |
Zeg9 |
I could |
| 09:33 |
Ragnar_ |
great :D |
| 09:33 |
Ragnar_ |
1. open Minetest, 2. Make a picture of the sunset :D |
| 09:33 |
Ragnar_ |
without your HUD! |
| 09:33 |
Zeg9 |
Ok, wait |
| 09:33 |
Ragnar_ |
can you? |
| 09:33 |
Ragnar_ |
thanks :D |
| 09:33 |
Zeg9 |
What size? |
| 09:34 |
Ragnar_ |
any... |
| 09:34 |
Ragnar_ |
im gonna use it as a banner, so im gonna scale it myself :D |
| 09:46 |
Jordach |
lol, netsplit |
| 09:47 |
|
VanessaE joined #minetest |
| 09:47 |
KikaRz |
poor VanessaE |
| 09:48 |
KikaRz |
Welcome Back! |
| 09:51 |
|
xy joined #minetest |
| 09:56 |
|
celeron55 joined #minetest |
| 09:57 |
Jordach |
good morning celeron55 |
| 09:58 |
|
rsiska joined #minetest |
| 10:07 |
KikaRz |
good morning ~perttu (celeron55) |
| 10:13 |
|
thomas joined #minetest |
| 10:22 |
|
Xenux joined #minetest |
| 10:23 |
|
john_minetest joined #minetest |
| 10:25 |
KikaRz |
Going to turn on my server 0.4.4 |
| 10:25 |
Ragnar_ |
hi KikaRz |
| 10:27 |
KikaRz |
hi Ragnar_ |
| 10:27 |
Ragnar_ |
hey KikaRz...you wanna cyber than xD |
| 10:28 |
KikaRz |
what? |
| 10:28 |
KikaRz |
cyber what? |
| 10:28 |
Ragnar_ |
LOL |
| 10:28 |
Ragnar_ |
youre...21, 22? |
| 10:28 |
Ragnar_ |
and you dont know what cyber-ing is :d |
| 10:29 |
KikaRz |
lol |
| 10:29 |
KikaRz |
22 |
| 10:31 |
Ragnar_ |
John_Minetest! |
| 10:31 |
KikaRz |
Ragnar_ wants to cyber with you |
| 10:31 |
KikaRz |
. |
| 10:31 |
KikaRz |
xd |
| 10:31 |
Ragnar_ |
NO! |
| 10:31 |
Ragnar_ |
i wanted to ask, that why did he name his game Project Perabird... |
| 10:31 |
Zeg9 |
my* |
| 10:32 |
Ragnar_ |
really? |
| 10:32 |
Ragnar_ |
why do i have to ask john then :d |
| 10:33 |
Zeg9 |
Because the name cames from him |
| 10:33 |
Zeg9 |
lol |
| 10:33 |
Ragnar_ |
ow :D |
| 10:33 |
Zeg9 |
came* |
| 10:34 |
|
q66 joined #minetest |
| 10:35 |
KikaRz |
http://minetest.net/forum/viewtopic.php?id=3910 |
| 10:35 |
KikaRz |
This mod sucks. |
| 10:35 |
KikaRz |
sorry for teelling this |
| 10:38 |
Jordach |
hello john_minetest |
| 10:41 |
Ragnar_ |
hi Jordach |
| 10:42 |
|
PilzAdam joined #minetest |
| 10:43 |
PilzAdam |
Hello everyone! |
| 10:46 |
KikaRz |
Jordach |
| 10:46 |
KikaRz |
you cheater... |
| 10:46 |
KikaRz |
you did a x-ray texture pack |
| 10:46 |
|
tango_ joined #minetest |
| 10:46 |
KikaRz |
http://minetest.com/2012/03/xray-by-jordach/ |
| 10:46 |
Jordach |
hey PilzAdam |
| 10:48 |
|
SpeedProg1 joined #minetest |
| 10:55 |
|
blaze joined #minetest |
| 11:11 |
|
Zeg9 joined #minetest |
| 11:22 |
|
Zeg9 left #minetest |
| 11:24 |
KikaRz |
hey |
| 11:24 |
KikaRz |
whats lava source giveme id? |
| 11:25 |
KikaRz |
and fire? |
| 11:25 |
KikaRz |
going to test one thing in my server |
| 11:25 |
PilzAdam |
default:lava_source fire:basic_flame |
| 11:26 |
KikaRz |
error: cannot give an unknown item |
| 11:26 |
|
john_minetest joined #minetest |
| 11:27 |
KikaRz |
going to find a bucket of lava |
| 11:32 |
KikaRz |
i guess i go t a lava protection |
| 11:40 |
|
berome joined #minetest |
| 11:49 |
|
blaze joined #minetest |
| 11:55 |
KikaRz |
who its johny ingame? |
| 11:55 |
KikaRz |
17:55:54: ERROR[main]: stack traceback: |
| 11:55 |
KikaRz |
In thread b77a1700: |
| 11:55 |
KikaRz |
/root/minetest-0.4.3/src/main.cpp:1741: int main(int, char**): Assertion '0' failed. |
| 11:55 |
KikaRz |
Debug stacks: |
| 11:55 |
KikaRz |
DEBUG STACK FOR THREAD b77a1700: |
| 11:55 |
KikaRz |
#0 int main(int, char**) |
| 11:55 |
KikaRz |
(Leftover data: #1 Dedicated server branch) |
| 11:55 |
KikaRz |
(Leftover data: #2 virtual void ServerMap::save(ModifiedState)) |
| 11:55 |
KikaRz |
(Leftover data: #3 virtual void ServerMap::saveBlock(MapBlock*)) |
| 11:55 |
KikaRz |
(Leftover data: #4 void ItemStack::serialize(std::ostream&) const) |
| 11:55 |
KikaRz |
Aborted |
| 11:55 |
KikaRz |
hate that bugs |
| 11:59 |
KikaRz |
got a problem |
| 12:01 |
KikaRz |
who's there? |
| 12:01 |
KikaRz |
Zeg9? |
| 12:08 |
berome |
kikaRz:(you are talking about Zegaton ?) |
| 12:08 |
KikaRz |
no |
| 12:08 |
berome |
ok |
| 12:08 |
KikaRz |
problem fixed |
| 12:08 |
berome |
:-) nice |
| 12:09 |
berome |
(I must go) |
| 12:09 |
|
berome left #minetest |
| 12:10 |
|
NekoGloop joined #minetest |
| 12:10 |
NekoGloop |
Meow~ |
| 12:11 |
KikaRz |
Who can try to enter? |
| 12:11 |
KikaRz |
Purr... |
| 12:11 |
KikaRz |
m13.servegame.com:30001 |
| 12:13 |
|
anunakki joined #minetest |
| 12:14 |
KikaRz |
who can try to enter? |
| 12:14 |
KikaRz |
m13.servegame.com:30001 |
| 12:28 |
|
Sudi joined #minetest |
| 12:34 |
|
Zeg9 joined #minetest |
| 12:43 |
KikaRz |
Welcome Back Zeg9 |
| 12:46 |
Zeg9 |
Thanks. |
| 12:46 |
Zeg9 |
o_o I just discovered what caused my minetest crashes... |
| 12:46 |
KikaRz |
what ? |
| 12:46 |
Zeg9 |
Is it possible that xchat notifications make minetest crash ? |
| 12:46 |
KikaRz |
No... |
| 12:46 |
Zeg9 |
Because it just crashed when you said that .. |
| 12:46 |
KikaRz |
windows? |
| 12:46 |
Zeg9 |
And it also happened when people was sending me pms |
| 12:47 |
KikaRz |
a sec |
| 12:47 |
Zeg9 |
And no, I'm on arch linux... |
| 12:48 |
Zeg9 |
Can you highlight me ? |
| 12:48 |
Zeg9 |
just to test |
| 12:48 |
KikaRz |
Zeg9, you're cute. |
| 12:48 |
Zeg9 |
Okay, it wasn't that... |
| 12:48 |
Zeg9 |
Then it might be because someone died on the server |
| 12:49 |
Zeg9 |
I'll do some testing, brb |
| 12:50 |
Zeg9 |
Ok, when someone dies on my server, all 0.4.4 client crash |
| 13:00 |
KikaRz |
18:57:04: ERROR[main]: ERROR: An unhandled exception occurred: ServerError: LuaError: error: ...4.3/bin/../games/minetest_game/mods/default/init.lua:1359: attempt to concatenate field 'item' (a userdata value) |
| 13:00 |
KikaRz |
18:57:04: ERROR[main]: stack traceback: |
| 13:00 |
KikaRz |
In thread b7774700: |
| 13:00 |
KikaRz |
/root/minetest-0.4.3/src/main.cpp:1741: int main(int, char**): Assertion '0' failed. |
| 13:00 |
KikaRz |
Debug stacks: |
| 13:00 |
KikaRz |
DEBUG STACK FOR THREAD b7774700: |
| 13:00 |
KikaRz |
#0 int main(int, char**) |
| 13:00 |
KikaRz |
(Leftover data: #1 Dedicated server branch) |
| 13:00 |
KikaRz |
(Leftover data: #2 virtual void ServerMap::save(ModifiedState)) |
| 13:00 |
KikaRz |
(Leftover data: #3 virtual void ServerMap::saveBlock(MapBlock*)) |
| 13:00 |
Zeg9 |
o_o it looks weird when you come back to 0.4.3 without trilinear filter |
| 13:00 |
thexyz |
learn to use pastebin.com |
| 13:00 |
KikaRz |
(Leftover data: #4 void ItemStack::serialize(std::ostream&) const) |
| 13:00 |
KikaRz |
Aborted |
| 13:01 |
KikaRz |
I got that problem |
| 13:01 |
KikaRz |
when some one enters the server |
| 13:01 |
KikaRz |
thexyz, pastebin is too laggy |
| 13:01 |
thexyz |
then gist.github.com |
| 13:01 |
thexyz |
anything |
| 13:01 |
KikaRz |
I cant use. |
| 13:01 |
thexyz |
except pasting in into chat |
| 13:01 |
Zeg9 |
KikaRz, try to update your minetest_game |
| 13:01 |
thexyz |
then somebody will mute you =( |
| 13:01 |
KikaRz |
Zeg9, it's 0.4.3 |
| 13:01 |
Zeg9 |
Since when does it do this? |
| 13:04 |
Sudi |
there are no monsters yet right? |
| 13:04 |
|
NakedFury joined #minetest |
| 13:09 |
* Jordach |
wonders why i used /ignore KikaRz all |
| 13:09 |
Jordach |
s/i/jordach |
| 13:18 |
Jordach |
sfan5 lol. |
| 13:19 |
PilzAdam |
https://github.com/celeron55/minetest/commit/fa76057e7f6811a8e7388a70d6fde7af61aa0bee |
| 13:19 |
PilzAdam |
what nodes in the default game should be attached? |
| 13:19 |
PilzAdam |
IMO junglegrass, torch, dry shrub, sign, sapling, rails, apples |
| 13:19 |
PilzAdam |
-apples |
| 13:19 |
Jordach |
yes yes yes yes yes yes |
| 13:20 |
Jordach |
+apples |
| 13:20 |
PilzAdam |
the attachment code looks at the node under the apples |
| 13:20 |
PilzAdam |
<thexyz> hm.. let me check some apple trees photos... |
| 13:22 |
* Jordach |
panic()s |
| 13:25 |
PilzAdam |
heh, i started to look a video on youtube, paused it to merge the attached_nodes thing and forget to look further |
| 13:29 |
Jordach |
s/a video/at a video/ |
| 13:37 |
|
ttk2 joined #minetest |
| 13:40 |
|
testeree joined #minetest |
| 13:43 |
testeree |
image minetest like this,it would be pure awesomeness ;) http://www.youtube.com/watch?v=_FjuPn7MXMs |
| 13:50 |
|
tango_ joined #minetest |
| 13:56 |
Sudi |
testeree: for what reason? thats just a 3d desktop enviroment |
| 13:56 |
|
doserj joined #minetest |
| 13:57 |
Sudi |
testeree: and as you can see hard to control...you are way faster with alt+tab than by walking to the screen^^ |
| 13:58 |
testeree |
Sudi: just to play and work simultaneously :P, hoping it won't spoil the fun :P |
| 13:59 |
Sudi |
get a second monitor...besides...actually playing and working at the same time not possible^^ |
| 14:00 |
FreeFull |
testeree: That would be horrible for actually getting things done |
| 14:02 |
|
anunnaki joined #minetest |
| 14:04 |
|
hmmmm joined #minetest |
| 14:05 |
|
cisoun1 joined #minetest |
| 14:08 |
|
tango_ joined #minetest |
| 14:23 |
thexyz |
anyone willing to add examples to wiki? http://wapi.minetest.ru/Category:MissingExample |
| 14:34 |
|
Sudi joined #minetest |
| 14:35 |
|
malar joined #minetest |
| 14:45 |
Jordach |
hey guys, has anyone noticed that we are at the same progression stage as minecraft was during indev/infdev |
| 14:47 |
|
simion314 joined #minetest |
| 14:48 |
simion314 |
hi all |
| 14:48 |
NakedFury |
I thought we were more into early beta |
| 14:50 |
|
jin_xi joined #minetest |
| 15:07 |
OldCoder |
Good morning |
| 15:09 |
|
babyface1031 joined #minetest |
| 15:09 |
NakedFury |
morning |
| 15:09 |
babyface1031 |
morning |
| 15:09 |
|
celeron55 joined #minetest |
| 15:13 |
simion314 |
i am trying to debug a mod, i am new to lua, how can I fix this call "print("314 turning on node at pos "..pos.tostring); " it seems pos.tostring is nil or i need to do tostring()? ? |
| 15:15 |
Zeg9 |
I think it's more tostring(pos) than pos.tostring, then I never used that function, so... |
| 15:15 |
PilzAdam |
simion314, there is a function minetest.pos_to_string(pos) |
| 15:16 |
PilzAdam |
or you can use dump(pos) |
| 15:16 |
KikaRz |
good afternoon OldCoder |
| 15:16 |
simion314 |
thx |
| 15:16 |
PilzAdam |
dump() converts everything into a string |
| 15:16 |
PilzAdam |
but the output of minetest.pos_to_string() is better readable |
| 15:17 |
PilzAdam |
in most cases i use dump() for debug output because im too lazy to type the other thing |
| 15:17 |
PilzAdam |
and it also doesnt crash if the field it nil |
| 15:19 |
OldCoder |
KikaRz, Hi |
| 15:19 |
OldCoder |
babyface1031, Hey |
| 15:20 |
babyface1031 |
hi OldCoder |
| 15:20 |
OldCoder |
NakedFury, how are you this fine day? |
| 15:20 |
NakedFury |
fine |
| 15:20 |
NakedFury |
super |
| 15:20 |
Jordach |
good morning OldCoder |
| 15:22 |
|
john_minetest joined #minetest |
| 15:22 |
|
shadowjay1 joined #minetest |
| 15:28 |
OldCoder |
Jordach, Hi! |
| 15:32 |
|
rubenwardy joined #minetest |
| 15:33 |
rubenwardy |
hi all |
| 15:43 |
simion314 |
anyone here is familiar with the mesecons code? i am trying to debug an issue, when moving an item with a piston ,it's powered state is not updated |
| 15:44 |
|
Doc22_ joined #minetest |
| 15:44 |
Doc22_ |
'ello |
| 15:45 |
Doc22_ |
KikaRz are you interested in making machines? |
| 15:45 |
KikaRz |
yep |
| 15:45 |
Doc22_ |
mesecons |
| 15:45 |
Doc22_ |
ok |
| 15:45 |
KikaRz |
yep |
| 15:45 |
Doc22_ |
ill give you ip |
| 15:45 |
KikaRz |
:) |
| 15:45 |
Doc22_ |
its 1.4 |
| 15:45 |
Doc22_ |
4.4* |
| 15:45 |
KikaRz |
1.4.4 ? |
| 15:45 |
KikaRz |
0.4.4? |
| 15:45 |
Doc22_ |
yes |
| 15:45 |
KikaRz |
xd |
| 15:45 |
Doc22_ |
yes |
| 15:45 |
Doc22_ |
lol |
| 15:45 |
KikaRz |
let me make on e thing in my server first |
| 15:45 |
Doc22_ |
http://sfan.sf.funpic.de/minetest-builds/c55/minetest-0.4.4-655bb52-win32.7z |
| 15:45 |
Doc22_ |
here is download for 4.4 |
| 15:46 |
KikaRz |
no thanks |
| 15:46 |
KikaRz |
i dont use that. |
| 15:46 |
KikaRz |
no OpenGL support |
| 15:46 |
KikaRz |
i got a custom one |
| 15:46 |
Doc22_ |
thats my server version |
| 15:46 |
Doc22_ |
oh ok |
| 15:46 |
KikaRz |
Doc22, its the same |
| 15:46 |
Doc22_ |
well is your version compatible |
| 15:46 |
KikaRz |
thexyz compiled me one |
| 15:46 |
Doc22_ |
oh nvm |
| 15:46 |
Doc22_ |
lol |
| 15:47 |
Doc22_ |
im lucky I get computer parts this christmas so that I can build custom pc |
| 15:47 |
Doc22_ |
it is going to be awesome, and it wont lag |
| 15:47 |
Doc22_ |
a change from the old 2000 pc |
| 15:47 |
Doc22_ |
lol |
| 15:48 |
Doc22_ |
2ghz |
| 15:48 |
Doc22_ |
1gb ram |
| 15:48 |
KikaRz |
wait |
| 15:48 |
Doc22_ |
lol |
| 15:48 |
Jordach |
doc22_ a) it probably will on a home connection, b) mesecons is always laggy, c) it's 0.4.4-dev |
| 15:48 |
KikaRz |
let me make here one thing |
| 15:48 |
KikaRz |
Jordach |
| 15:48 |
KikaRz |
as i said yesterday: |
| 15:48 |
Doc22_ |
ok |
| 15:48 |
KikaRz |
FUTURE 0.4.4 = 0.4.4 -.- |
| 15:48 |
Doc22_ |
lol |
| 15:48 |
Doc22_ |
I know mesecons is laggy |
| 15:49 |
Doc22_ |
its not that bad on my server, and mesecons is awesome |
| 15:49 |
Doc22_ |
im making ram modules right now :D |
| 15:49 |
Doc22_ |
then I will make a processor |
| 15:49 |
Doc22_ |
and a screen... |
| 15:49 |
KikaRz |
im uploading to my server a thing |
| 15:49 |
Jordach |
doc22_ dont expect them to work |
| 15:49 |
Doc22_ |
ok |
| 15:49 |
Doc22_ |
I just finished a good ram design |
| 15:50 |
Doc22_ |
it works. |
| 15:51 |
KikaRz |
lol |
| 15:51 |
KikaRz |
i made a mini fridge |
| 15:51 |
KikaRz |
that connects usb to the computer |
| 15:51 |
KikaRz |
and computer powers him up |
| 15:52 |
Doc22_ |
lol |
| 15:52 |
KikaRz |
so cool to put the water there |
| 15:52 |
KikaRz |
or the coca cola |
| 15:52 |
KikaRz |
or a salad... |
| 15:52 |
KikaRz |
soon ill make a microwave. |
| 15:52 |
Doc22_ |
ok so far I have a partial-five bit address selector |
| 15:53 |
Doc22_ |
and I have 4 bits of data for each address |
| 15:53 |
Doc22_ |
I will be expanding |
| 15:53 |
OldCoder |
Doc22, hi |
| 15:54 |
Doc22_ |
heo oldcoder |
| 15:54 |
Doc22_ |
hey* |
| 15:54 |
KikaRz |
Doc22_ , in few moments ill be free |
| 15:54 |
Doc22_ |
ok |
| 15:54 |
Doc22_ |
ill pm ip |
| 15:54 |
KikaRz |
Doc22_, can you send me ip and port in pm? |
| 15:54 |
KikaRz |
ok |
| 15:54 |
Doc22_ |
XD |
| 15:55 |
|
Renoki joined #minetest |
| 15:55 |
rubenwardy |
Minetest is really improving |
| 15:56 |
OldCoder |
rubenwardy, Indeed |
| 15:56 |
OldCoder |
rubenwardy, Your own work will help |
| 15:57 |
rubenwardy |
I would help in the C++, but i have no idea where to get started |
| 15:58 |
* PilzAdam |
too |
| 15:58 |
rubenwardy |
https://github.com/celeron55/minetest/branches lots of choice |
| 15:59 |
rubenwardy |
"on demand visuals" does that mean textures are only loaded when they are needed? |
| 16:01 |
Jordach |
wait, when did minetest have shaders https://github.com/celeron55/minetest/tree/244896b8a981f07ca8384e08253cc96eedd054b2 |
| 16:01 |
PilzAdam |
the shaders_v4 branch is aweseome |
| 16:01 |
PilzAdam |
just tried |
| 16:02 |
Jordach |
can i has pics? |
| 16:02 |
PilzAdam |
sure |
| 16:02 |
Jordach |
cheers, i might write a shader just like sonicethers |
| 16:02 |
KikaRz |
that can lag... |
| 16:02 |
Jordach |
(and glistening water) |
| 16:03 |
rubenwardy |
when will shaders be in master? How laggy are they? |
| 16:03 |
Sudi |
wow how many people are working on this project...its amazing how active it is here |
| 16:03 |
Jordach |
this is what the modding api should be like http://en.wikipedia.org/wiki/LOLCODE |
| 16:03 |
PilzAdam |
Jordach, http://www.zimg.eu/i/3772979522 |
| 16:04 |
PilzAdam |
there are 2 test shaders |
| 16:04 |
jin_xi |
im in ur loopz eating your rams |
| 16:04 |
PilzAdam |
rubenwardy, it doesnt lag for me; i get >200 FPS with max view in current upstream, so... |
| 16:05 |
|
Calinou joined #minetest |
| 16:05 |
rubenwardy |
cool, what about dependancey and older systems? |
| 16:05 |
OldCoder |
Calinou, Hi |
| 16:05 |
Jordach |
http://en.wikipedia.org/wiki/LOLCODE Calinou - we need this for minetests apu |
| 16:05 |
Jordach |
api |
| 16:05 |
KikaRz |
lol |
| 16:05 |
rubenwardy |
if it does not work on older systems, can you turn it of and it still works? |
| 16:05 |
KikaRz |
apu its from simpsons |
| 16:06 |
rubenwardy |
as in minetest still runs |
| 16:06 |
KikaRz |
i can test |
| 16:06 |
PilzAdam |
rubenwardy, yes, shaders will be configureable |
| 16:06 |
KikaRz |
i got a old system |
| 16:06 |
KikaRz |
and graphics card |
| 16:06 |
Calinou |
KikaRz: accelerated processin unit :p |
| 16:06 |
Calinou |
processing* |
| 16:07 |
OldCoder |
I will be backing and rebuilding worlds today. Does anybody wish to suggest changes or updates? |
| 16:11 |
|
harrison joined #minetest |
| 16:12 |
KikaRz |
guys |
| 16:12 |
KikaRz |
how i turn a unknown file into a directory? |
| 16:12 |
Sudi |
KikaRz: mkdir^^ |
| 16:13 |
KikaRz |
Sudi |
| 16:13 |
KikaRz |
I DONT WANT TO CREATE A FOLDER |
| 16:13 |
Calinou |
you have to remove the file first :p |
| 16:13 |
KikaRz |
<KikaRz> how i turn a unknown file into a directory? |
| 16:13 |
KikaRz |
Calinou, cant |
| 16:13 |
Calinou |
unknown file? what unknown file? |
| 16:13 |
|
Doc22_ joined #minetest |
| 16:13 |
Sudi |
yeah that doesn't make sense |
| 16:13 |
Sudi |
if the file is unknow |
| 16:13 |
Sudi |
how do you know its name |
| 16:14 |
Doc22_ |
its a government conspiracy |
| 16:14 |
Doc22_ |
lol |
| 16:14 |
Calinou |
CONS-PIRACY! |
| 16:14 |
Sudi |
constant piracy |
| 16:14 |
Sudi |
i see |
| 16:14 |
Sudi |
... |
| 16:14 |
Doc22_ |
NO! |
| 16:14 |
Doc22_ |
ther must be no arranging of 1s and 0s |
| 16:14 |
KikaRz |
WHAT? |
| 16:14 |
Calinou |
const-correct piracy |
| 16:14 |
Doc22_ |
if that thing is "Copy-Righted" |
| 16:14 |
Sudi |
haha |
| 16:15 |
Sudi |
right |
| 16:15 |
Doc22_ |
Contsipation-piracy |
| 16:15 |
Doc22_ |
hrmm |
| 16:15 |
Doc22_ |
well i gave it a try |
| 16:15 |
Doc22_ |
lol |
| 16:16 |
Sudi |
yeah... |
| 16:16 |
Doc22_ |
:/ |
| 16:16 |
Doc22_ |
why do I make stupid puns |
| 16:18 |
simion314 |
anyone here is familiar with the mesecons code? i am trying to debug an issue, when moving an item with a piston ,it's powered state is not updated |
| 16:18 |
Doc22_ |
is protectors mod in |
| 16:18 |
Doc22_ |
it causes glitches |
| 16:19 |
Doc22_ |
if a protector blocks is placed 5 blocks away from the block being moved |
| 16:19 |
|
Doc22_ left #minetest |
| 16:19 |
|
Doc22_ joined #minetest |
| 16:20 |
PilzAdam |
Jordach, andother screenshot by c55: http://misc.minetest.net/screenshot_1463910756.png |
| 16:20 |
PilzAdam |
*another |
| 16:21 |
* Jordach |
does not see any difference |
| 16:21 |
KikaRz |
i did... |
| 16:21 |
KikaRz |
SHIT :D |
| 16:21 |
KikaRz |
deleted the whole server |
| 16:22 |
Doc22_ |
lol |
| 16:22 |
* Jordach |
wants motion blur |
| 16:23 |
KikaRz |
hey |
| 16:23 |
KikaRz |
whats the first thing to do when we compile a server? |
| 16:23 |
KikaRz |
cmake . RUN what? |
| 16:23 |
PilzAdam |
-DRUN_IN_PLACE=1 |
| 16:24 |
KikaRz |
not that |
| 16:24 |
KikaRz |
thats not for server |
| 16:24 |
PilzAdam |
-DBUILD_CLIENT=0 |
| 16:24 |
KikaRz |
DBUILD_SERVER=1 ? |
| 16:24 |
PilzAdam |
thats default |
| 16:25 |
PilzAdam |
default is CLIENT=1 and SERVER=1 |
| 16:25 |
KikaRz |
building server. |
| 16:34 |
|
Jousway joined #minetest |
| 16:37 |
|
MilanFIN joined #minetest |
| 16:38 |
Jordach |
ah, ctrl + tab, so loving in a tabbed browser :( |
| 16:38 |
Jordach |
-( +) |
| 16:40 |
Calinou |
PilzAdam: looks like less intense smooth lighting |
| 16:41 |
PilzAdam |
it makes the top part one step brighter than the rest |
| 16:41 |
Calinou |
like in minecraft 8D |
| 16:42 |
* Jordach |
now notices the changes |
| 16:42 |
Jordach |
FUCK. |
| 16:43 |
Jordach |
it should also follow the sun, just like sonic ethers shader mod |
| 16:43 |
Jordach |
;) |
| 16:44 |
Doc22_ |
oh yeah, that mod looks awesome |
| 16:44 |
Jordach |
doc22_, THESE ARE NOT MODS. |
| 16:44 |
Doc22_ |
I support that kind of change |
| 16:44 |
Doc22_ |
i know |
| 16:44 |
|
Garp joined #minetest |
| 16:44 |
Doc22_ |
i meant that implementing something like it would be good |
| 16:44 |
Garp |
Hi. |
| 16:44 |
Doc22_ |
hi |
| 16:45 |
Jordach |
good, and also correct using 4.4 instead of 0.4.4 (remember, the 0.x.x is good.) |
| 16:45 |
Doc22_ |
i meant that sonic ethers shader mod looks awesome |
| 16:45 |
Doc22_ |
all right |
| 16:45 |
Jordach |
yeah, thats what i hope on making |
| 16:45 |
Doc22_ |
it looks awesome |
| 16:45 |
Doc22_ |
good feel for blocky world |
| 16:46 |
Jordach |
(i could just use lighting at everyhour, so thats 24 different angles |
| 16:46 |
PilzAdam |
Doc22_, it looks much more awesome in game! |
| 16:46 |
Jordach |
) |
| 16:46 |
Doc22_ |
less... bland. |
| 16:46 |
jin_xi |
http://i.imgur.com/sNyNn.jpg with shaders |
| 16:46 |
Doc22_ |
yeah I bet it does |
| 16:46 |
Doc22_ |
wow |
| 16:46 |
Doc22_ |
that looks awesome |
| 16:46 |
Calinou |
shaders for lighting are not very useful |
| 16:46 |
PilzAdam |
the water is also MCish |
| 16:46 |
Calinou |
nodeboxes still don't support smooth lighting :( |
| 16:46 |
Garp |
Question: Under debian squeeze, ran the server with "minecraftserevr" under some user. Truybed to connect localhost 30000 but always timeout on client side. However teh server can see the connection, but the client dont. Any aidea? Thanks. |
| 16:46 |
Doc22_ |
something that could be implemented |
| 16:46 |
KikaRz |
guys |
| 16:47 |
KikaRz |
got a problem |
| 16:47 |
KikaRz |
WARNING: system-wide share found at "/root/minetestserver2/minetest-0.4.3/bin/.." |
| 16:47 |
KikaRz |
22:46:34: ERROR[main]: Subgame [] could not be found. |
| 16:47 |
Calinou |
Garp: minecraftserver? |
| 16:47 |
Doc22_ |
is small waves on the water |
| 16:47 |
Calinou |
KikaRz: do not host a server as root |
| 16:47 |
Jordach |
sfan5 - can you compile shaders_v4 branch please in celeron55/minetest? |
| 16:47 |
Calinou |
are you crazy? |
| 16:47 |
KikaRz |
Calinou |
| 16:47 |
KikaRz |
im not hosting |
| 16:47 |
sfan5 |
Jordach: maybe |
| 16:47 |
Garp |
Calinou: sorry. /usr/games/minetestserver |
| 16:47 |
KikaRz |
im testing |
| 16:47 |
Calinou |
Garp: try 127.0.0.1 port 30000 |
| 16:47 |
Jordach |
sfan5 thanks. I wanna toy with this stuff |
| 16:47 |
KikaRz |
i got that problem |
| 16:47 |
KikaRz |
WARNING: system-wide share found at "/root/minetestserver2/minetest-0.4.3/bin/.." |
| 16:47 |
KikaRz |
22:46:34: ERROR[main]: Subgame [] could not be found. |
| 16:47 |
KikaRz |
who can help me? |
| 16:47 |
Garp |
Calinou: I cannot tape '7' in the server boxc |
| 16:47 |
Doc22_ |
oh i know |
| 16:48 |
Garp |
Could not find EKEY_CODE, using orig. X11 keycode instead: 16 |
| 16:48 |
Garp |
Any number works, but 7 |
| 16:48 |
Calinou |
that happens when you use non-qwerty layout |
| 16:48 |
Calinou |
probably azerty here |
| 16:48 |
Calinou |
like me 8) |
| 16:48 |
Doc22_ |
you need to put in the minetest-0.4.4/games/ the world file |
| 16:48 |
Doc22_ |
I think |
| 16:48 |
Garp |
Yes. |
| 16:48 |
Garp |
Any workaround? |
| 16:48 |
Calinou |
solution: switch to qwerty temporarily |
| 16:48 |
Doc22_ |
err |
| 16:48 |
Calinou |
:> |
| 16:48 |
KikaRz |
world file? |
| 16:48 |
Doc22_ |
the game settings |
| 16:48 |
KikaRz |
it generates |
| 16:48 |
KikaRz |
if its not |
| 16:48 |
Doc22_ |
ill email it |
| 16:48 |
Doc22_ |
or something |
| 16:48 |
KikaRz |
ah |
| 16:48 |
Garp |
OK. I'll try. |
| 16:48 |
Garp |
Dont have time now, let you know :) |
| 16:48 |
Doc22_ |
you know what I speak of? |
| 16:48 |
KikaRz |
need to use the minetest_game |
| 16:48 |
Doc22_ |
yes |
| 16:49 |
Garp |
See ya and thanks for the help and the work :) |
| 16:49 |
Doc22_ |
put the file in /games |
| 16:49 |
Calinou |
Garp: no idea what de you use, but in xfce it takes like 10 seconds to change layout |
| 16:49 |
Calinou |
menu > settings > keyboard > layout > english.. |
| 16:49 |
Calinou |
you could also set up a shortcut, like alt+shift |
| 16:50 |
Doc22_ |
he left lol |
| 16:50 |
KikaRz |
Doc22 |
| 16:50 |
Doc22_ |
yes |
| 16:50 |
KikaRz |
forget. |
| 16:51 |
Doc22_ |
ohkay... |
| 16:51 |
Doc22_ |
ill just work on my ram modules then |
| 16:52 |
Doc22_ |
lol |
| 16:52 |
KikaRz |
Doc22_ |
| 16:52 |
Doc22_ |
? |
| 16:52 |
KikaRz |
im installing the minetest_game |
| 16:52 |
Doc22_ |
ok |
| 16:52 |
* Jordach |
has worked out how to save 512k in mc redstone modules |
| 16:52 |
|
Garp joined #minetest |
| 16:52 |
Garp |
Hi. |
| 16:52 |
Doc22_ |
[09:49] <Calinou> Garp: no idea what de you use, but in xfce it takes like 10 seconds to change layout [09:49] <Calinou> menu > settings > keyboard > layout > english.. [09:49] <Calinou> you could also set up a shortcut, like alt+shift |
| 16:53 |
|
doserj joined #minetest |
| 16:54 |
Garp |
Fastest and works better than keyboard layout: vi ~/.mintest/mintest.conf edit the server entry. |
| 16:54 |
Garp |
Thanks again, have to go. |
| 16:56 |
KikaRz |
Doc22_ just need mesecons? |
| 16:56 |
Doc22_ |
and worldedit |
| 16:56 |
KikaRz |
and tht? |
| 16:57 |
Doc22_ |
yes |
| 16:57 |
KikaRz |
and creative? |
| 16:57 |
Doc22_ |
ja |
| 16:59 |
Doc22_ |
just make a new world if you want |
| 16:59 |
sfan5 |
.sv |
| 16:59 |
sfan5 |
.c 1+1 |
| 17:00 |
jin_xi |
sfan5: its 2 |
| 17:00 |
|
MinetestBot joined #minetest |
| 17:00 |
Jordach |
.sa |
| 17:00 |
sfan5 |
jin_xi: i know |
| 17:00 |
Jordach |
.sv |
| 17:00 |
sfan5 |
.sv |
| 17:00 |
MinetestBot |
sfan5: NotObamaLand | notobama.freedns.mobi:30000 up (98.305%) |
| 17:00 |
MinetestBot |
Jordach: M13's Server (0.4.3) | m13.servegame.com:30001 down |
| 17:01 |
Jordach |
.c 3.142 * (E * r) |
| 17:01 |
MinetestBot |
Sorry, no result. |
| 17:01 |
NakedFury |
the command .sv shows a random server? |
| 17:01 |
Jordach |
yes |
| 17:01 |
NakedFury |
would it be possible to say .sv jordacH to shows his server ? |
| 17:02 |
Jordach |
no |
| 17:02 |
NakedFury |
ok then possible so it doesnt repeat a server before going through them all? |
| 17:03 |
Calinou |
<Garp> Fastest and works better than keyboard layout: vi ~/.mintest/mintest.conf edit the server entry. |
| 17:03 |
Calinou |
lolvi |
| 17:03 |
|
Zeg9 joined #minetest |
| 17:03 |
Jordach |
hehehe, this t-flip-flop ram works brilliant with mesecons |
| 17:04 |
OldCoder |
Zeg9, wb |
| 17:06 |
rubenwardy |
OldCoder: https://github.com/rubenwardy/Minetest-Website |
| 17:06 |
|
sfan5[iPod] joined #minetest |
| 17:08 |
|
rubenwardy left #minetest |
| 17:08 |
|
rubenwardy joined #minetest |
| 17:08 |
|
rubenwardy left #minetest |
| 17:11 |
|
MilanFIN joined #minetest |
| 17:13 |
KikaRz |
Guys, who got a good minetest.conf for a server? |
| 17:13 |
KikaRz |
(creative mesecons server) |
| 17:15 |
|
babyface1031 joined #minetest |
| 17:15 |
simion314 |
I think i found the fix for my mesecon update problem, I submited a commit with the fix |
| 17:28 |
OldCoder |
KikaRz, I do |
| 17:28 |
OldCoder |
Hold on |
| 17:29 |
KikaRz |
you do what? |
| 17:29 |
KikaRz |
ah |
| 17:29 |
KikaRz |
i need a non laggy one |
| 17:29 |
KikaRz |
because im not with a minetest.conf file |
| 17:29 |
KikaRz |
in the vps |
| 17:29 |
OldCoder |
Yes |
| 17:29 |
OldCoder |
One moment |
| 17:30 |
OldCoder |
http://minetest.org/minetest-conf.txt |
| 17:30 |
OldCoder |
Maybe that with creative mode added |
| 17:30 |
OldCoder |
Hold on |
| 17:31 |
KikaRz |
OldCoder |
| 17:31 |
KikaRz |
did you entered the vps? |
| 17:31 |
OldCoder |
http://minetest.org/veritas-conf.txt |
| 17:31 |
OldCoder |
How about that one? |
| 17:31 |
OldCoder |
KikaRz, you mean now? |
| 17:31 |
OldCoder |
I could |
| 17:31 |
KikaRz |
23:31:49: ACTION[ServerThread]: KikaRz times out. List of players: Doc |
| 17:31 |
KikaRz |
23:31:53: ACTION[ServerThread]: Doc times out. List of players: |
| 17:31 |
KikaRz |
everyone timed out |
| 17:31 |
OldCoder |
KikaRz, it is probably the network |
| 17:31 |
OldCoder |
Hold on |
| 17:32 |
KikaRz |
i restarted it |
| 17:32 |
KikaRz |
need to add the minetest.conf |
| 17:32 |
OldCoder |
All right |
| 17:32 |
KikaRz |
the server is too glitchy without it |
| 17:32 |
OldCoder |
CPU load is low |
| 17:32 |
OldCoder |
Hold on |
| 17:33 |
KikaRz |
CPU Load of? |
| 17:33 |
OldCoder |
Hang on |
| 17:33 |
OldCoder |
Where did the folder move to |
| 17:33 |
KikaRz |
of my server? (m13) |
| 17:33 |
KikaRz |
m13 server and mine |
| 17:34 |
OldCoder |
Am I on the wrong VPS? |
| 17:34 |
OldCoder |
PM |
| 17:40 |
|
TForsman joined #minetest |
| 17:42 |
|
NekoGloop joined #minetest |
| 17:44 |
Jordach |
hey NekoGloop |
| 17:45 |
|
babyface1031 joined #minetest |
| 17:47 |
NekoGloop |
Meow. |
| 17:48 |
Jordach |
nearly there with my tp |
| 17:48 |
* Jordach |
exhales |
| 17:48 |
Jordach |
and i've got foooooooooddddd! |
| 17:48 |
Jordach |
ah yes, the microwave "beep! beep!" |
| 17:49 |
* john_minetest |
is a zombie |
| 17:53 |
* KikaRz |
kills john_minetest with a bottle of lava in the head |
| 17:53 |
* KikaRz |
continues: and some TNT from Creeper Heart. |
| 17:53 |
* john_minetest |
growls and tries to reach KikaRz |
| 17:53 |
* KikaRz |
runs |
| 17:54 |
* john_minetest |
attracts other zombies towards the situation with his growls |
| 17:54 |
|
ecube joined #minetest |
| 17:55 |
* john_minetest |
looks around |
| 17:56 |
|
sparky joined #minetest |
| 17:56 |
|
doserj joined #minetest |
| 17:59 |
* KikaRz |
hides behind a truck that is flying |
| 18:01 |
PilzAdam |
http://www.zimg.eu/i/3294693692 |
| 18:01 |
KikaRz |
That is? |
| 18:01 |
KikaRz |
Give us a description |
| 18:01 |
PilzAdam |
A screenshot |
| 18:01 |
PilzAdam |
:-p |
| 18:03 |
KikaRz |
whats Sand-Blasted Stone Brick ID? |
| 18:03 |
PilzAdam |
its either an old version of Minecraft or the latest Minetest with shaders and MC TP |
| 18:04 |
|
Octupus joined #minetest |
| 18:05 |
NekoGloop |
PilzAdam: Minetest. You can tell because of the tree shapes. |
| 18:06 |
Octupus |
hi |
| 18:06 |
PilzAdam |
and the water textures |
| 18:06 |
Zeg9 |
The fog, too |
| 18:06 |
Zeg9 |
Or... |
| 18:06 |
VanessaE |
hi all. |
| 18:07 |
Zeg9 |
Hello! |
| 18:07 |
OldCoder |
hi |
| 18:07 |
NekoGloop |
Meow to one and all! :3 |
| 18:07 |
OldCoder |
hey |
| 18:07 |
PilzAdam |
VanessaE, seen the screenshot: http://www.zimg.eu/i/3294693692 |
| 18:07 |
VanessaE |
NekoGloop: wtf do YOU want!??? |
| 18:07 |
VanessaE |
;) |
| 18:07 |
Octupus |
hi vanessae |
| 18:07 |
VanessaE |
PilzAdam: saw it. Not bad. Sure a far better look than the default orange sand :) |
| 18:07 |
NekoGloop |
VanessaE: I didnt HL you immediately like i do every time i come on. |
| 18:07 |
Octupus |
hi OldCoder |
| 18:08 |
VanessaE |
PilzAdam: also saw the "shader" one with the water being not quite 1 block high. nice. |
| 18:08 |
OldCoder |
Hi |
| 18:08 |
VanessaE |
NekoGloop: just playing :) |
| 18:08 |
NekoGloop |
Er, like i get HL'd all the time immediately when i come on. |
| 18:08 |
Octupus |
im going to start my mod now |
| 18:11 |
|
john_minetest joined #minetest |
| 18:13 |
Jordach |
hey john_minetest |
| 18:17 |
Jordach |
VanessaE, PilzAdam this is what i wish to do with the shaders http://www.youtube.com/watch?v=fgXVYCy73tc |
| 18:18 |
PilzAdam |
Jordach, we all do.... |
| 18:18 |
VanessaE |
Jordach: glwt. |
| 18:23 |
NakedFury |
if minetest does ever have such visuals we should throw a party |
| 18:24 |
|
doserj joined #minetest |
| 18:26 |
Jordach |
http://www.youtube.com/watch?v=XDZA1Js1zqs VanessaE - your pack with dat shader |
| 18:27 |
Jordach |
(think of you pack) |
| 18:27 |
Jordach |
your |
| 18:27 |
NakedFury |
really awesome |
| 18:27 |
VanessaE |
looks nice |
| 18:28 |
NakedFury |
I like how that shader makes the vegetation move |
| 18:28 |
VanessaE |
but won't such fancy stuff kill performance? |
| 18:28 |
Jordach |
at the end of the video you can see the player model shadow |
| 18:29 |
VanessaE |
I see it. |
| 18:30 |
Jordach |
VanessaE - i now get 60fps dead with the latest git on windows |
| 18:30 |
Jordach |
with the fancy stuff on |
| 18:31 |
VanessaE |
cool |
| 18:31 |
VanessaE |
performance for me has been improving lately too |
| 18:31 |
VanessaE |
brb |
| 18:31 |
Jordach |
(i dont know what causes this, but it works a lot better on 6 year old hardware) |
| 18:35 |
KikaRz |
Hi VanessaE |
| 18:36 |
|
Fabiter213 joined #minetest |
| 18:37 |
Fabiter213 |
Hey! :) |
| 18:37 |
Fabiter213 |
Is anybody here? :) |
| 18:45 |
Fabiter213 |
Hey! :) |
| 18:49 |
|
Octupus joined #minetest |
| 18:52 |
|
Doc22_ joined #minetest |
| 18:53 |
Doc22_ |
hey Octupus |
| 18:53 |
Doc22_ |
are you interested in mesecons machines |
| 18:53 |
Octupus |
hi |
| 18:53 |
Doc22_ |
im making a computer |
| 18:53 |
Doc22_ |
aww but i got to go now |
| 18:54 |
Doc22_ |
ill talk later about mesecons machines |
| 18:54 |
KikaRz |
lol |
| 18:56 |
|
Morrolan joined #minetest |
| 18:58 |
|
leo_rockway joined #minetest |
| 18:59 |
babyface1031 |
sorry Octupus i was cooking D: |
| 18:59 |
Octupus |
o well its ok |
| 18:59 |
KikaRz |
What? |
| 19:00 |
KikaRz |
I love cooked chicken |
| 19:00 |
KikaRz |
and porkshop |
| 19:00 |
KikaRz |
*chop |
| 19:00 |
KikaRz |
dislike McDonald |
| 19:10 |
|
Muadtralk joined #minetest |
| 19:11 |
|
Renoki joined #minetest |
| 19:15 |
KikaRz |
Hi Muadtralk :D |
| 19:19 |
Fabiter213 |
Hey guys, can anybody help me? |
| 19:21 |
|
Kokorobet joined #minetest |
| 19:21 |
|
Kokorobet joined #minetest |
| 19:21 |
|
Garp joined #minetest |
| 19:21 |
Garp |
Hi. |
| 19:22 |
PilzAdam |
hi |
| 19:22 |
Fabiter213 |
Hey. :9 |
| 19:22 |
Fabiter213 |
Can someone help me pleas? |
| 19:22 |
* OldCoder |
is AFK for about half an hour on errands |
| 19:23 |
jin_xi |
fuck yeah i fixed the screen flicker issue on my laptop! |
| 19:23 |
PilzAdam |
Fabiter213, just ask your question |
| 19:23 |
Garp |
Question (debian squeeze): when I run minetest standalone, things seems fione. When I run a serveur (minetestserver) on one side and connect a client. Things are funny: I can fly, cross through matter withouyt any problem, strange. Any idea? Thanks. |
| 19:23 |
PilzAdam |
nobody will answer to stupid questions like "can someone help me?" |
| 19:23 |
OldCoder |
Fabiter213, state question please |
| 19:23 |
Fabiter213 |
Yeah, i see |
| 19:24 |
Fabiter213 |
If i close Minetest, and restart it, i allways spawn under the erth, can i fix this? |
| 19:24 |
OldCoder |
Yes |
| 19:24 |
neko259 |
VanessaE: Do you want to push anything else to my nature mod? I'm going to try refactoring it and releasing a version with your latest commits... |
| 19:24 |
OldCoder |
You can edit the player file that records the position |
| 19:24 |
neko259 |
And my vines don't work after those changes. |
| 19:24 |
jin_xi |
PilzAdam: do you know a way to force update light? |
| 19:24 |
PilzAdam |
Garp, in the singleplayer the fly mode is disabled in default |
| 19:24 |
OldCoder |
It will be in one of two places |
| 19:25 |
OldCoder |
Either in the minetest.conf file or in a file in the players folder |
| 19:25 |
PilzAdam |
Garp, but on servers you maybe have the fly priv and can fly |
| 19:25 |
OldCoder |
Fabiter213, ^ |
| 19:25 |
Fabiter213 |
Okey.. :) Thank you. |
| 19:25 |
PilzAdam |
jin_xi, place a node |
| 19:25 |
PilzAdam |
with light_source ~= 0 |
| 19:26 |
Fabiter213 |
OldCoder ^^* |
| 19:26 |
Garp |
PilzAdam: and cross through matter? What are the options to set things as on single mode on the server ? |
| 19:26 |
KikaRz |
people |
| 19:26 |
KikaRz |
Here's a tip if you're a boy |
| 19:26 |
leo_rockway |
jin_xi: the walking light mod used an invisible node that forced the light update. |
| 19:27 |
PilzAdam |
Garp, with "K" you can switch fly mode |
| 19:27 |
leo_rockway |
but it glitched a bit |
| 19:27 |
KikaRz |
tell your girlfriend: I Hate my Nose. Because, it makes me get hungry, it makes me get annoyed... it makes me get with water in the mouth. |
| 19:27 |
jin_xi |
problem is light in large buildings |
| 19:27 |
KikaRz |
Just one thing... i love my nose because i can smell your beauty. |
| 19:27 |
jin_xi |
i might give walkable light thing a try |
| 19:27 |
Garp |
PilzAdam: so the client can decide about the physics on the server side? Hum.. I'll see, thanks. |
| 19:27 |
KikaRz |
thats a good thing to tell to your girlfriend |
| 19:27 |
KikaRz |
:P |
| 19:28 |
Calinou |
Garp: you need fly privilege to fly :p |
| 19:28 |
PilzAdam |
Garp, the client needs the "fly" privilege wich is set by the server |
| 19:28 |
Calinou |
and fast privilege to move faster |
| 19:28 |
KikaRz |
use: |
| 19:28 |
KikaRz |
default_privs = fly, fast, interact, shout |
| 19:28 |
KikaRz |
in your minetest.conf |
| 19:28 |
Garp |
I dont want to fly... |
| 19:28 |
leo_rockway |
fly privileges also allow you to walk through solid objects |
| 19:28 |
KikaRz |
lol |
| 19:28 |
KikaRz |
its like noclip |
| 19:29 |
Calinou |
it IS noclip |
| 19:29 |
PilzAdam |
wtf is noclip? |
| 19:29 |
Fabiter213 |
How can i set up a server? :) |
| 19:29 |
PilzAdam |
./minetestserver |
| 19:30 |
Garp |
default_privs = interact, shout |
| 19:30 |
Garp |
(on server side) |
| 19:30 |
Fabiter213 |
I cant understand your awnsers, what you mean.. :( |
| 19:30 |
KikaRz |
just change to fly, fast, interact, shout |
| 19:30 |
Garp |
default_game = minetest |
| 19:31 |
Garp |
(I dont understand if that's meaningful or just a string) |
| 19:31 |
KikaRz |
Fabiter213, just compile the game |
| 19:31 |
Octupus |
what are we talking about |
| 19:31 |
KikaRz |
in the vps |
| 19:31 |
KikaRz |
and ./minetestserver |
| 19:31 |
KikaRz |
cd bin |
| 19:31 |
KikaRz |
./minetestserver |
| 19:31 |
Fabiter213 |
Sorry, my question was bad, i mean, how or can i setup a server, who i can play in multiplayer* |
| 19:31 |
Fabiter213 |
My bad |
| 19:32 |
KikaRz |
Fabiter213 |
| 19:32 |
PilzAdam |
.wik Server |
| 19:32 |
KikaRz |
First: OS? |
| 19:32 |
MinetestBot |
"Setting up a server in such a way so that others may connect to it via the internet takes some time, and a little technical know-how." - http://wiki.minetest.com/wiki/Server |
| 19:32 |
KikaRz |
OS = Operating System |
| 19:32 |
PilzAdam |
Fabiter213, go to the link the bot mentioned |
| 19:33 |
Fabiter213 |
Yeah, thanks, did this work with a real Server too? |
| 19:33 |
Fabiter213 |
A root Server? |
| 19:35 |
PilzAdam |
whats a "root server"? |
| 19:35 |
Fabiter213 |
Do you know what a VServer (Virtual Server) Is? |
| 19:36 |
Fabiter213 |
Other wise, a root Server is a computer, onley used to be a server. |
| 19:37 |
KikaRz |
LOL |
| 19:37 |
KikaRz |
.wik root |
| 19:37 |
MinetestBot |
"There is currently no text in this page." - http://wiki.minetest.com/wiki/Root |
| 19:37 |
KikaRz |
lol |
| 19:37 |
KikaRz |
.wik Server |
| 19:37 |
Jordach |
anyways, im heading off to a friends, night all |
| 19:37 |
MinetestBot |
"Setting up a server in such a way so that others may connect to it via the internet takes some time, and a little technical know-how." - http://wiki.minetest.com/wiki/Server |
| 19:37 |
Jordach |
(ill be back about 4pm gmt+0) |
| 19:37 |
Calinou |
PilzAdam: noclip is flying through walls |
| 19:37 |
KikaRz |
ok |
| 19:38 |
KikaRz |
a/b |
| 19:38 |
KikaRz |
.c 85/43*2 |
| 19:38 |
MinetestBot |
3.95348837 |
| 19:38 |
Calinou |
(or well, walking through walls too) |
| 19:38 |
KikaRz |
.c pi |
| 19:38 |
Calinou |
.c 1/3 |
| 19:38 |
MinetestBot |
3.14159265 |
| 19:38 |
MinetestBot |
0.333333333 |
| 19:38 |
KikaRz |
.c pi |
| 19:38 |
MinetestBot |
3.14159265 |
| 19:38 |
Calinou |
only 9 digits :( |
| 19:38 |
KikaRz |
*-* |
| 19:38 |
KikaRz |
love pi. |
| 19:38 |
Calinou |
. 2^2^2^2^2^2^2^2^2^2^2^2^2^2^2^2^2^2^2^2^ |
| 19:38 |
KikaRz |
3.14159265 |
| 19:38 |
Calinou |
c. 2^2^2^2^2^2^2^2^2^2^2^2^2^2^2^2^2^2^2^2 |
| 19:38 |
KikaRz |
fail |
| 19:38 |
Calinou |
:p |
| 19:38 |
PilzAdam |
if you like pi you may also like e |
| 19:39 |
Calinou |
bot didn't reply |
| 19:39 |
KikaRz |
.c 2^2^2^2^2^2^2^2^2^2^2 |
| 19:39 |
MinetestBot |
Sorry, no result. |
| 19:39 |
KikaRz |
you did the account wrong |
| 19:39 |
KikaRz |
its .c |
| 19:39 |
KikaRz |
not c. |
| 19:39 |
KikaRz |
or . |
| 19:39 |
Calinou |
k |
| 19:39 |
Calinou |
.c -1² |
| 19:39 |
MinetestBot |
Sorry, no result. |
| 19:39 |
KikaRz |
.c e |
| 19:39 |
MinetestBot |
2.71828183 |
| 19:39 |
Calinou |
.c 2² |
| 19:39 |
MinetestBot |
Sorry, no result. |
| 19:39 |
Calinou |
no ²? :( |
| 19:39 |
Calinou |
.c sqrt(-1) |
| 19:39 |
MinetestBot |
i |
| 19:39 |
Calinou |
lol |
| 19:39 |
PilzAdam |
.c 2^2 |
| 19:39 |
MinetestBot |
4 |
| 19:39 |
Calinou |
"sqrt(-1) love you!" < minecraft splash |
| 19:39 |
KikaRz |
.c 5,34*106 |
| 19:39 |
MinetestBot |
566,04 |
| 19:40 |
KikaRz |
COOL |
| 19:40 |
KikaRz |
but not 106 |
| 19:40 |
Calinou |
.c KikaRz+PilzAdam |
| 19:40 |
MinetestBot |
Sorry, no result. |
| 19:40 |
Calinou |
:< |
| 19:40 |
KikaRz |
:( |
| 19:40 |
KikaRz |
.c Calinou+pi |
| 19:40 |
MinetestBot |
Sorry, no result. |
| 19:40 |
KikaRz |
xd |
| 19:40 |
KikaRz |
.help |
| 19:40 |
KikaRz |
no help command :( |
| 19:40 |
KikaRz |
.g KikaRz+Calinou |
| 19:40 |
MinetestBot |
KikaRz: http://irc.minetest.ru/minetest-dev/2012-11-19 |
| 19:41 |
KikaRz |
ohohohoho |
| 19:41 |
KikaRz |
.g celeron55+Doc22 |
| 19:41 |
MinetestBot |
KikaRz: http://irc.minetest.ru/minetest-dev/2012-11-17 |
| 19:41 |
KikaRz |
Doc22, are you there? |
| 19:42 |
Calinou |
.c raspberry*pi |
| 19:42 |
MinetestBot |
Sorry, no result. |
| 19:42 |
KikaRz |
.c pi*e*pi+e |
| 19:42 |
MinetestBot |
29.5466481 |
| 19:42 |
leo_rockway |
.wik mobs |
| 19:42 |
MinetestBot |
"Minetest had very few mobs before the 0.4.0 version." - http://wiki.minetest.com/wiki/Mobs |
| 19:42 |
KikaRz |
.wik Calinou |
| 19:42 |
Calinou |
.c e |
| 19:42 |
MinetestBot |
2.71828183 |
| 19:43 |
MinetestBot |
"There is currently no text in this page." - http://wiki.minetest.com/wiki/Calinou |
| 19:43 |
leo_rockway |
thank you, MinetestBot |
| 19:43 |
Calinou |
.g MinetestBot |
| 19:43 |
PilzAdam |
.wik celeron55 |
| 19:43 |
MinetestBot |
Calinou: No results found for 'MinetestBot'. |
| 19:43 |
Calinou |
lol |
| 19:43 |
MinetestBot |
"celeron55 leads quite a private life and so not much is known about his early life." - http://wiki.minetest.com/wiki/Celeron55 |
| 19:43 |
KikaRz |
lol |
| 19:43 |
KikaRz |
.g Minetest |
| 19:43 |
MinetestBot |
KikaRz: http://minetest.net/ |
| 19:43 |
Calinou |
you highlighted him.. |
| 19:43 |
KikaRz |
.d hp |
| 19:43 |
leo_rockway |
I like the idea of fireflies... |
| 19:43 |
leo_rockway |
the walking light mod should use fireflies in a jar |
| 19:43 |
KikaRz |
.q test |
| 19:43 |
KikaRz |
.o test |
| 19:43 |
KikaRz |
what are this bot commands? |
| 19:44 |
KikaRz |
.g KikaRz |
| 19:44 |
MinetestBot |
KikaRz: http://steamcommunity.com/id/KikaRz1 |
| 19:44 |
PilzAdam |
.tw github |
| 19:44 |
KikaRz |
Ok, i know that i have steam |
| 19:44 |
MinetestBot |
We'll be performing network maintenance tomorrow, Saturday 12/1, at 6am Pacific. Impact, if any, is expected to be brief. (@github) |
| 19:44 |
KikaRz |
.tw Calinou |
| 19:44 |
MinetestBot |
Raspberry ketones, miracle fat burner? If Dr. Oz says so http://www.actermites.com/checkclient/98grahamwilliams/ (@Calinou) |
| 19:44 |
KikaRz |
lol |
| 19:44 |
KikaRz |
.tw MichaelJackson |
| 19:45 |
MinetestBot |
THRILLER ALBUM RELEASED 30 YEARS AGO TODAY! What is your favorite song from the album? #Thriller @michaeljackson pic.twitter.com/ijjbWVC5 (@MichaelJackson) |
| 19:45 |
KikaRz |
That's strange... it continues tweeting... |
| 19:45 |
KikaRz |
XD |
| 19:45 |
Calinou |
.tw minetest |
| 19:45 |
MinetestBot |
hi this is me (@minetest) |
| 19:45 |
KikaRz |
.tw JustinBieber |
| 19:45 |
Calinou |
KikaRz: i am not on twitter 8) |
| 19:45 |
MinetestBot |
the whole team is here. TORONTO today....u wont forget! #BELIEVEtour #Homecoming #STADIUMstatus (@JustinBieber) |
| 19:45 |
KikaRz |
AAAAAAAAA! |
| 19:45 |
Calinou |
.tw linux |
| 19:45 |
KikaRz |
Justin Bieber isnt deaaaaaad! |
| 19:45 |
MinetestBot |
Ubuntu 12.10 "Quantal Quetzal" released! #Ubuntu #Linux (@linux) |
| 19:45 |
KikaRz |
AAAAAA! |
| 19:45 |
Calinou |
lol |
| 19:46 |
KikaRz |
.tw ubuntu |
| 19:46 |
Muadtralk |
.tw shutup |
| 19:46 |
Calinou |
old news |
| 19:46 |
MinetestBot |
Sorry, couldn't get a tweet from https://twitter.com/shutup?1354391162.14 (@shutup) |
| 19:46 |
MinetestBot |
Don't miss the last webinar of the #cloud series #OpenStack and #Ubuntu: #Dreamhost #public cloud on #Openstack http://bit.ly/SSYJEL (@ubuntu) |
| 19:46 |
KikaRz |
LOL |
| 19:46 |
Calinou |
.tw amazon ads |
| 19:46 |
MinetestBot |
Calinou: Give me a link, a username, or a tweet id |
| 19:46 |
KikaRz |
.tw sex |
| 19:46 |
KikaRz |
ups. |
| 19:46 |
MinetestBot |
╲â•â”â”â”â”╮╲╲â•â”â”â”â”â”â”â”â”â”â”â”â•® ╲┃â•â•®â•â•®â”ƒâ•²â•²â”ƒ~30 AutoFOLLOWBacks ┗┫â”â”â”┓┣┛╲╰┳╮@http://twitclub.com ╲┃╰â”â”╯┃â”â”â”╯╰â”â”â”â”â”â”â”â”â”╯ ╲╰┳â”â”┳╯─►http://6.ly/gy9 (@sex) |
| 19:46 |
Calinou |
stop spamming :p |
| 19:46 |
Calinou |
gtg, bye |
| 19:46 |
KikaRz |
Ohohohoho... |
| 19:46 |
Calinou |
nice slashes you have there MinetestBot |
| 19:47 |
KikaRz |
not from minetestbot |
| 19:47 |
KikaRz |
but yes from @sex twitter |
| 19:47 |
KikaRz |
xd |
| 19:47 |
KikaRz |
.t minetest |
| 19:47 |
Muadtralk |
.tw CommieWaffles |
| 19:47 |
KikaRz |
.tw Portugal |
| 19:47 |
MinetestBot |
Hey, @chetplease, look what I found. http://yfrog.com/obr7zoej (@CommieWaffles) |
| 19:47 |
MinetestBot |
Chegou o frio. (@Portugal) |
| 19:47 |
KikaRz |
lol |
| 19:48 |
KikaRz |
Chegou o frio = Cold arrived here |
| 19:48 |
KikaRz |
.tw Spain |
| 19:48 |
MinetestBot |
@joebertl Whenever you want! Take care! Best! (@Spain) |
| 19:48 |
KikaRz |
.tw UnitedKingdom |
| 19:48 |
MinetestBot |
Sorry, couldn't get a tweet from https://twitter.com/UnitedKingdom?1354391297.31 (@UnitedKingdom) |
| 19:48 |
KikaRz |
.tw USA |
| 19:48 |
MinetestBot |
So along with your friends and family, wish everyone the heartiest thanks. Happy Thanksgiving Day! (@USA) |
| 19:48 |
Calinou |
.tw twitter |
| 19:48 |
MinetestBot |
The Twitter Fiction Festival begins tomorrow: http://blog.twitter.com/2012/11/twitter-fiction-festival-selections.html. Everyone can participate! Tell your story with #twitterfiction. (@twitter) |
| 19:48 |
PilzAdam |
.tw MinetestBot |
| 19:48 |
KikaRz |
.tw VenomExtreme |
| 19:48 |
MinetestBot |
Sorry, couldn't get a tweet from https://twitter.com/MinetestBot?1354391328.2 (@MinetestBot) |
| 19:48 |
MinetestBot |
I liked a @YouTube video from @venomextreme http://youtu.be/N3gr5fTb4Cw?a Sobrevivente - ZombiU (@VenomExtreme) |
| 19:49 |
KikaRz |
My uncle *-* |
| 19:49 |
KikaRz |
VenomExtreme is my uncle :) |
| 19:49 |
Muadtralk |
.tw VerminSupreme |
| 19:49 |
KikaRz |
better: Eduardo Faria |
| 19:49 |
MinetestBot |
"All politicians are vermin, and I'm the best vermin of them all" #VerminSupreme #AnarchistRunningForPresident (@VerminSupreme) |
| 19:49 |
KikaRz |
.tw xchat |
| 19:49 |
MinetestBot |
Sorry, couldn't get a tweet from https://twitter.com/xchat?1354391378.29 (@xchat) |
| 19:49 |
KikaRz |
.tw office |
| 19:49 |
MinetestBot |
Flash Fill means you can get more done in less time. Take a look at this new feature in #Excel 2013. http://msft.it/6011pjCJ #OfficePreview (@office) |
| 19:49 |
KikaRz |
Let me see... |
| 19:49 |
Calinou |
.tw windows |
| 19:50 |
MinetestBot |
Have you tried Snap in @Windows 8 to use two apps at once? See more tips and tricks here: http://bit.ly/Win8101 #Windows8 (@windows) |
| 19:50 |
Calinou |
roflcopter |
| 19:50 |
KikaRz |
.tw windowssucks |
| 19:50 |
MinetestBot |
Sorry, couldn't get a tweet from https://twitter.com/windowssucks?1354391407.85 (@windowssucks) |
| 19:50 |
KikaRz |
lets create a twitter |
| 19:50 |
KikaRz |
nick: windowssucks |
| 19:50 |
KikaRz |
.tw BillGates |
| 19:50 |
MinetestBot |
On World Aids Day, it’s important to remember that if we stay the course we can end this epidemic. http://b-gat.es/11sGbRM (@BillGates) |
| 19:52 |
KikaRz |
last twee |
| 19:52 |
KikaRz |
.tw joaoadriano3 |
| 19:52 |
MinetestBot |
@Feromonas_ A livestream está muito boa para um Computador que esta a morrer (como o meu estava antes de o limpar) e um pc fraco.. (@joaoadriano3) |
| 19:52 |
KikaRz |
thats my brother |
| 19:52 |
NakedFury |
could you stop the crap. you did the same stuff yesterday |
| 19:52 |
KikaRz |
... i said: |
| 19:52 |
KikaRz |
last TWEET |
| 19:52 |
KikaRz |
. |
| 19:58 |
|
STH joined #minetest |
| 20:04 |
KikaRz |
Hey |
| 20:04 |
KikaRz |
who got IRCBot code? |
| 20:04 |
KikaRz |
i want to enable it in my server |
| 20:12 |
|
STHGOM joined #minetest |
| 20:15 |
|
STHGOM joined #minetest |
| 20:17 |
|
Fabiter213 left #minetest |
| 20:22 |
Garp |
Question: When I start minetestserver and connect with the client, I get a working environement. If I quite the client and reconnect, I'm only abel to get a full black window where the landscape should be; why? Thanks. |
| 20:23 |
PilzAdam |
Garp, maybe you spawned in a node |
| 20:24 |
Garp |
PilzAdam: I connected using a new user and it seems to be "night" |
| 20:24 |
thexyz |
what minetest version are you on? |
| 20:25 |
Garp |
PilzAdam: (I saw stars) |
| 20:25 |
Garp |
thexyz: the one from debian squeeze |
| 20:25 |
Garp |
21:18:46: ACTION[main]: minetest with SER_FMT_VER_HIGHEST=20, VER=0.3.1 RUN_IN_P |
| 20:25 |
thexyz |
you should better compile newer one yourself, this one is quite old |
| 20:25 |
|
STHGOM joined #minetest |
| 20:26 |
Garp |
thexyz: I just realized that :( |
| 20:26 |
PilzAdam |
compiling is easier than installing a package |
| 20:26 |
Garp |
Sorry to have bothered you. I'll do that first and the complain again if needed ;) |
| 20:26 |
Garp |
PilzAdam: I dont think so however. Installing is just "aptitude install minetest minetestserver" |
| 20:27 |
Garp |
compiling will at least requiere several other steps |
| 20:27 |
PilzAdam |
compiling is just: make . -DRUN_IN_PLACE=1 && make -j16 |
| 20:27 |
PilzAdam |
and at the first run you have to install the dependencies |
| 20:27 |
PilzAdam |
but the command for that is for ubuntu/debian in the README |
| 20:28 |
Garp |
PilzAdam: Si I at least have to read the README ;) |
| 20:28 |
thexyz |
s/make/cmake/ |
| 20:28 |
PilzAdam |
oh, yea typo |
| 20:29 |
Garp |
which version should I download? latest stable or more recent ? |
| 20:29 |
PilzAdam |
latest git version |
| 20:29 |
babyface1031 |
RealBadAngel you on? |
| 20:30 |
Garp |
PilzAdam: OK, lets live dangerously ! |
| 20:33 |
Garp |
Where is the install doc? (I'm lazy, sorry) |
| 20:33 |
thexyz |
README |
| 20:33 |
PilzAdam |
https://github.com/PilzAdam/minetest/blob/master/README.txt#L78 |
| 20:34 |
Garp |
Thanks :) |
| 20:35 |
Garp |
Pretty detailed steps, thanks. |
| 20:36 |
KikaRz |
thexyz :D |
| 20:37 |
|
Muadtralk left #minetest |
| 20:39 |
thexyz |
are there any modding tutorials except jeija's & rubenwardy's ones? |
| 20:40 |
Garp |
(building) |
| 20:40 |
Octupus |
MinetestBot,define juice |
| 20:41 |
|
Muadtralk joined #minetest |
| 20:43 |
KikaRz |
Octupus, define (sqrt-1) |
| 20:43 |
Octupus |
? |
| 20:44 |
|
Muadtralk left #minetest |
| 20:46 |
neko259 |
VanessaE: Nevermind, I've already commited. |
| 20:46 |
|
STHGOM joined #minetest |
| 20:48 |
Garp |
Nice :) Thanks, seems to work :) |
| 20:48 |
PilzAdam |
so you run 0.4.4-dev now? |
| 20:49 |
Garp |
Yes, that's what my client says |
| 20:54 |
simion314 |
hpw do i set fly privilage in single player creative? |
| 20:55 |
PilzAdam |
simion314, /grant singleplayer fly,fast |
| 20:56 |
OldCoder |
Hi |
| 20:56 |
OldCoder |
Back for a while |
| 20:56 |
KikaRz |
Hi OldCoder |
| 20:57 |
Zeg9 |
Hey OldCoder |
| 20:57 |
PilzAdam |
Hi OC the OP |
| 20:57 |
|
kaeza joined #minetest |
| 20:58 |
kaeza |
hello |
| 20:58 |
kaeza |
got to wrong channel :( |
| 20:58 |
Zeg9 |
... |
| 20:58 |
OldCoder |
Zeg9, I was delayed but will restart Zegaton now after removing Teleport as John requested |
| 20:58 |
kaeza |
now that's better |
| 20:58 |
OldCoder |
kaeza, hi |
| 20:58 |
kaeza |
hey OldCoder |
| 20:58 |
Zeg9 |
OldCoder, did you just disable recipe or the teleporters entirely ? |
| 20:58 |
kaeza |
what's up? |
| 21:00 |
OldCoder |
Zeg9, I have not made the change yet; wished to ask you what you'd prefer |
| 21:01 |
OldCoder |
What was it John was requesting? |
| 21:01 |
OldCoder |
kaeza, I am preparing to rebuild the worlds |
| 21:01 |
OldCoder |
Changes are welcome |
| 21:01 |
OldCoder |
Backups will be made too |
| 21:01 |
Zeg9 |
Well, I agreed with john to only disable the crafting recipe, so people can only have teleporters if admins trust them. |
| 21:01 |
kaeza |
OldCoder: ok |
| 21:01 |
Zeg9 |
Btw, the mod is ready |
| 21:01 |
KikaRz |
guys |
| 21:02 |
KikaRz |
how to give permissions to run into a sh app? |
| 21:02 |
KikaRz |
in linux? |
| 21:02 |
Zeg9 |
chmod +x <file> |
| 21:03 |
kaeza |
ermm... KikaRz |
| 21:03 |
KikaRz |
ok |
| 21:04 |
kaeza |
packmod.sh already has +x |
| 21:04 |
KikaRz |
no |
| 21:04 |
KikaRz |
it hasnt |
| 21:04 |
kaeza |
GAWD! |
| 21:04 |
KikaRz |
i need to give it permissions |
| 21:05 |
KikaRz |
thats a big problem for your lua thing |
| 21:05 |
kaeza |
hmm... wait |
| 21:05 |
kaeza |
let me test it |
| 21:05 |
OldCoder |
Zeg9, all right |
| 21:05 |
OldCoder |
Zeg9, you may email or http://sendspace.com/ it if you wish |
| 21:07 |
|
PilzAdam joined #minetest |
| 21:08 |
Zeg9 |
OldCoder: http://ompldr.org/vZ2l5cw |
| 21:08 |
Zeg9 |
Please remove inv_skin, both are not compatible with each other |
| 21:12 |
|
Dogzilla131 joined #minetest |
| 21:12 |
OldCoder |
Zeg9, all right ty |
| 21:12 |
OldCoder |
Dogzilla131, Hi! |
| 21:12 |
OldCoder |
Dogzilla131, is moreflags working for you? |
| 21:12 |
OldCoder |
Dogzilla131, the new blog of flags seems to be unknown blocks ATM |
| 21:12 |
Dogzilla131 |
Hi Oldcoder |
| 21:13 |
Dogzilla131 |
lem met check |
| 21:13 |
MiJyn |
hi |
| 21:13 |
Dogzilla131 |
*let |
| 21:13 |
Dogzilla131 |
hi |
| 21:13 |
Octupus |
hi Dogzilla131 |
| 21:13 |
MiJyn |
how is everyone? |
| 21:13 |
Octupus |
hi Mijyn |
| 21:13 |
Dogzilla131 |
ho octu |
| 21:13 |
Zeg9 |
Hello. |
| 21:14 |
MiJyn |
wow, I guess I have started a "hello" party lol |
| 21:14 |
Octupus |
:) |
| 21:14 |
Zeg9 |
Yes. |
| 21:14 |
STHGOM |
hi |
| 21:14 |
Zeg9 |
See? |
| 21:14 |
Octupus |
hi PilzAdam |
| 21:14 |
PilzAdam |
sup |
| 21:15 |
Octupus |
nada mucho |
| 21:15 |
STHGOM |
i am sparky |
| 21:15 |
babyface1031 |
Octupus i have to get off for a bit i never got a responce back from rba i dont think he is on right now |
| 21:16 |
Dogzilla131 |
oh yeah |
| 21:16 |
Octupus |
he might be at work and see ya later face |
| 21:16 |
Dogzilla131 |
hey oldcoder the mod |
| 21:17 |
Dogzilla131 |
is okay, is just in version 0.2 has words not numbers |
| 21:17 |
kaeza |
hey Dogzilla131 |
| 21:17 |
Dogzilla131 |
i got more organize so i chenge the name of the png files so then it turns to an unknown |
| 21:18 |
Dogzilla131 |
hi kaeza |
| 21:18 |
kaeza |
hey Octupus |
| 21:18 |
Octupus |
hi kaeza |
| 21:18 |
kaeza |
what's up? |
| 21:20 |
Dogzilla131 |
the sky |
| 21:21 |
kaeza |
wrong |
| 21:21 |
Octupus |
XD lolz |
| 21:21 |
kaeza |
the first floor |
| 21:21 |
kaeza |
:) |
| 21:21 |
OldCoder |
Dogzilla131, so you can fix the flags block? |
| 21:22 |
Zeg9 |
Have to go, bye all! |
| 21:23 |
STHGOM |
bye |
| 21:25 |
kaeza |
slow |
| 21:29 |
kaeza |
YAY! just got my 100th forum post!!1!!eleven!!! |
| 21:29 |
KikaRz |
.. |
| 21:30 |
* PilzAdam |
got over 1000... |
| 21:30 |
OldCoder |
All the worlds will shut down for a bit for updates and backups |
| 21:30 |
STHGOM |
I don't have any |
| 21:30 |
OldCoder |
Doc22, Dogzilla131 warn the others if any on your world |
| 21:30 |
KikaRz |
updates of what, OldCodeR' |
| 21:30 |
KikaRz |
? |
| 21:30 |
OldCoder |
KikaRz, minor fixes |
| 21:30 |
OldCoder |
No big deal |
| 21:30 |
KikaRz |
what bugs? |
| 21:31 |
OldCoder |
They are mostly in Zegaton world |
| 21:31 |
kaeza |
PilzAdam: I'll see you when I have my 1000th and you have like 176485 posts :) |
| 21:31 |
PilzAdam |
anyone want a hacked client to be able to sprint? https://github.com/PilzAdam/minetest/commit/b81ee85039acbffd07c64c6c1ea1ecc90b7351f9 |
| 21:32 |
KikaRz |
No thanks PilzAdam |
| 21:32 |
NakedFury |
add that to normal game. the ability to sprint and player stamina |
| 21:32 |
NakedFury |
would be appreciated |
| 21:32 |
KikaRz |
just to X Ray |
| 21:32 |
KikaRz |
XD |
| 21:32 |
OldCoder |
17:37:37: ERROR[main]: ERROR: An unhandled exception occurred: Player::deSerialize(): PlayerArgsEnd not found |
| 21:33 |
OldCoder |
I could really use advice |
| 21:33 |
OldCoder |
ALL the worlds are doing that ATM |
| 21:33 |
|
anunakki joined #minetest |
| 21:34 |
OldCoder |
|
| 21:34 |
OldCoder |
About 15 worlds are reporting that error |
| 21:34 |
OldCoder |
It may take a while to clean this up |
| 21:34 |
OldCoder |
Ideas would be appreciated |
| 21:34 |
OldCoder |
|
| 21:34 |
KikaRz |
ok |
| 21:34 |
KikaRz |
I want to give one idea |
| 21:35 |
OldCoder |
Feel free |
| 21:35 |
KikaRz |
every world got a block symbolizing it. |
| 21:35 |
NakedFury |
same error again |
| 21:35 |
OldCoder |
NakedFury, yes |
| 21:35 |
OldCoder |
I will fix it but wish to prevent it! |
| 21:38 |
OldCoder |
Worlds are down while I clean this up |
| 21:42 |
KikaRz |
Guys |
| 21:42 |
KikaRz |
tell me a ubuntu best editor |
| 21:42 |
KikaRz |
that is more used to edit minetest.conf and other files |
| 21:42 |
PilzAdam |
vim for the win |
| 21:42 |
KikaRz |
... |
| 21:42 |
thexyz |
PilzAdam: +1 |
| 21:43 |
thexyz |
also try emacs, some people prefer it over vim |
| 21:45 |
OldCoder |
PilzAdam, thexyz, NakedFury no thoughts on the corruption I assume |
| 21:45 |
STHGOM |
hello? |
| 21:45 |
STHGOM |
ok |
| 21:45 |
STHGOM |
nvm |
| 21:45 |
STHGOM |
how do you make a password? |
| 21:46 |
PilzAdam |
OldCoder, you said you want to patch minetest to prevent this |
| 21:46 |
OldCoder |
Yes |
| 21:46 |
PilzAdam |
and? |
| 21:46 |
OldCoder |
Actually the server framework |
| 21:46 |
OldCoder |
It will take about 4 hours for that |
| 21:46 |
OldCoder |
So not today |
| 21:46 |
OldCoder |
Wish to find actual cause if possible |
| 21:46 |
OldCoder |
My fix will be a workaround |
| 21:48 |
thexyz |
OldCoder: on players files corruption? |
| 21:48 |
thexyz |
i can only suggest you to `smartctl -a /dev/sda` |
| 21:49 |
|
MinetestBot joined #minetest |
| 21:51 |
OldCoder |
thexyz, it is a VPS but ty |
| 21:52 |
OldCoder |
thexyz, the issue is truncation to zero length on shutdown |
| 21:54 |
kaeza |
.c 1 |
| 21:54 |
MinetestBot |
1 |
| 21:54 |
kaeza |
good |
| 21:54 |
KikaRz |
.c 1+1 |
| 21:54 |
MinetestBot |
2 |
| 21:54 |
KikaRz |
GOOD DOG! |
| 21:54 |
KikaRz |
now... 2+2 ? |
| 21:54 |
KikaRz |
.c 2+2 |
| 21:54 |
MinetestBot |
4 |
| 21:54 |
kaeza |
.c fact(3) |
| 21:54 |
MinetestBot |
Sorry, no result. |
| 21:54 |
KikaRz |
Good job... now this is a hard one! |
| 21:54 |
KikaRz |
.c 4+4 |
| 21:54 |
MinetestBot |
8 |
| 21:54 |
kaeza |
.c factorial(3) |
| 21:54 |
MinetestBot |
Sorry, no result. |
| 21:54 |
KikaRz |
OMG, YOU'RE AMAZING |
| 21:54 |
kaeza |
how do you do factorials? |
| 21:54 |
KikaRz |
final question... |
| 21:55 |
KikaRz |
.c 99999999999999999+999999999999999999999999*2 |
| 21:55 |
MinetestBot |
2.0000001 × 10^(24) |
| 21:55 |
KikaRz |
you got 59333 QI |
| 21:55 |
kaeza |
.c 1e-4 |
| 21:55 |
MinetestBot |
0.0001 |
| 21:55 |
KikaRz |
.c 1pi-4 |
| 21:55 |
MinetestBot |
-0.858407346 |
| 21:55 |
KikaRz |
.c 1pi-3 |
| 21:55 |
thexyz |
OldCoder: well, that basically means i can't suggest anything |
| 21:55 |
MinetestBot |
0.141592654 |
| 21:55 |
thexyz |
now stop |
| 21:55 |
FreeFull |
.c phi |
| 21:55 |
MinetestBot |
1.61803399 |
| 21:55 |
KikaRz |
thexyz |
| 21:55 |
KikaRz |
whe are just testing bot |
| 21:55 |
KikaRz |
:P |
| 21:55 |
FreeFull |
.c tau |
| 21:55 |
MinetestBot |
Sorry, no result. |
| 21:55 |
thexyz |
this is not #bottest |
| 21:56 |
KikaRz |
Not my faul |
| 21:56 |
KikaRz |
*fault |
| 21:56 |
NakedFury |
completely your fault |
| 21:56 |
thexyz |
i'll have to +q you |
| 21:56 |
KikaRz |
... thexyz, kick the bot so. |
| 21:56 |
NakedFury |
you keep just messing with it |
| 21:56 |
kaeza |
thexyz: is this yours or from sfan? |
| 21:56 |
KikaRz |
... who started? kaeza |
| 21:56 |
KikaRz |
<kaeza> .c 1 |
| 21:56 |
KikaRz |
<MinetestBot> 1 |
| 21:56 |
KikaRz |
<kaeza> good |
| 21:56 |
KikaRz |
<KikaRz> .c 1+1 |
| 21:56 |
KikaRz |
<MinetestBot> 2 |
| 21:56 |
KikaRz |
<KikaRz> GOOD DOG! |
| 21:57 |
kaeza |
KikaRz: yeah, but I just tested it, not FLOODED it |
| 21:57 |
NakedFury |
yes kaeza did it and then you kept doing it |
| 21:57 |
KikaRz |
... kaeza, this is not #bottest |
| 21:57 |
NakedFury |
you go over the limit |
| 21:57 |
KikaRz |
as thexyz said. |
| 21:57 |
OldCoder |
Not this again |
| 21:57 |
OldCoder |
thexyz, ty |
| 21:57 |
OldCoder |
I am busy repairing 15 worlds |
| 21:57 |
OldCoder |
No bot battles please |
| 21:58 |
kaeza |
thexyz: is this yours or from sfan? |
| 21:58 |
KikaRz |
away |
| 21:58 |
KikaRz |
sfan i guess |
| 21:59 |
KikaRz |
kaeza; your irc bot (minetest) feedback: ill give a 2,3/10 |
| 21:59 |
KikaRz |
Reason: Having a LOT of bugs and problems in installing |
| 21:59 |
kaeza |
it's not a bot |
| 21:59 |
KikaRz |
... |
| 21:59 |
KikaRz |
IRCBot. |
| 21:59 |
kaeza |
and your copy of cmake is broken |
| 21:59 |
KikaRz |
no its not. |
| 22:02 |
KikaRz |
RealBadAngel, why you and mesecons mod creator, dont make a fusion and make 2 in 1? |
| 22:03 |
kaeza |
KikaRz: because not everybody wants technic? |
| 22:03 |
KikaRz |
kaeza, i didnt talked to you. |
| 22:03 |
kaeza |
... |
| 22:07 |
Garp |
Are there really some monster at night ? |
| 22:07 |
Garp |
I never saw anything yet ? |
| 22:07 |
KikaRz |
No |
| 22:07 |
KikaRz |
Just in Caves |
| 22:07 |
KikaRz |
and in 0.4.1 +++ versions are rare |
| 22:08 |
Garp |
Is there any tip to find coal and metal ? |
| 22:09 |
Garp |
thanks for your anwsre :) |
| 22:09 |
NakedFury |
coal and metal= iron I guess are very common |
| 22:10 |
|
Renoki joined #minetest |
| 22:10 |
Garp |
Have to read more ;) |
| 22:11 |
Garp |
the website doesnt give much informations about gameplay |
| 22:11 |
NakedFury |
coal can spawn up to 64+ levels |
| 22:11 |
kaeza |
Garp: monsters or "mobs" were removed since 0.4.2 I think |
| 22:11 |
kaeza |
they are part of mods now |
| 22:12 |
kaeza |
search the forums for "Animals", "MOB Framework", "Simple Mobs", and "Slimes" |
| 22:13 |
Garp |
kaeza: is there a "supported" or "standard" list of mods ? |
| 22:13 |
kaeza |
the "standard" mods are part of "minetest_game" |
| 22:14 |
Garp |
What appends when adding mods in an already existing world ? |
| 22:14 |
kaeza |
depends |
| 22:14 |
kaeza |
some mods act at map generation phase |
| 22:14 |
PilzAdam |
kaeza, not since 0.4.2 but since early 0.4-dev |
| 22:14 |
kaeza |
PilzAdam: yes |
| 22:14 |
kaeza |
sorry |
| 22:15 |
kaeza |
Garp: other mods act through "ABMs" |
| 22:15 |
PilzAdam |
ABM = active block modifier |
| 22:15 |
kaeza |
or Active Block Modifiers. i.e: they work in realtime |
| 22:16 |
Garp |
I see |
| 22:16 |
PilzAdam |
the spawning is the only downside of my Simple Mobs mod |
| 22:16 |
kaeza |
yet others provide global things like new chat commands |
| 22:16 |
PilzAdam |
after some time your whole world is full of sheep |
| 22:17 |
kaeza |
PilzAdam: yeah :) |
| 22:17 |
PilzAdam |
and Im currently too lazy to implement something on mapgen |
| 22:18 |
kaeza |
Garp: If you're looking for recommendations |
| 22:18 |
kaeza |
I suggest farming farming_plus, plantlife, moreblocks, moreores |
| 22:18 |
PilzAdam |
I suggest to wait until farming is upstream |
| 22:19 |
kaeza |
If you're into FPS-ish things (something like Ace of Spades) I suggest gunmod and rifle |
| 22:20 |
kaeza |
PilzAdam: what's new in farming? haven't checked in a while |
| 22:20 |
|
opticlove joined #minetest |
| 22:20 |
OldCoder |
Dogzilla131, is there a new moreflags? |
| 22:20 |
PilzAdam |
kaeza, nothing |
| 22:20 |
kaeza |
oh |
| 22:21 |
kaeza |
Garp: you still there? |
| 22:22 |
Garp |
Yes, a bit lost ;) |
| 22:22 |
Garp |
I just would like some bad stuff to get a reason to build things against |
| 22:22 |
kaeza |
so was I my first time in MT |
| 22:23 |
NakedFury |
right now only players would be bad stuff for you |
| 22:23 |
NakedFury |
no monsters yet |
| 22:23 |
Garp |
OK, I see. |
| 22:23 |
Garp |
Then I'll connect to existing servers to see |
| 22:23 |
NakedFury |
doesn't mean there won't be |
| 22:23 |
|
rsiska joined #minetest |
| 22:24 |
PilzAdam |
if you are paranoid you dont need mobs... |
| 22:24 |
Garp |
Well, hom many lines would change a sheep into something able to do damage like a player ? |
| 22:24 |
Garp |
lol PilzAdam |
| 22:24 |
kaeza |
vombies and dungeon masters do |
| 22:24 |
OldCoder |
U.S. worlds work is proceeding. Would anybody like new mods or fixes? |
| 22:25 |
PilzAdam |
Ill got to sleep now |
| 22:25 |
kaeza |
OldCoder: is there a PvP server? |
| 22:25 |
OldCoder |
c u |
| 22:25 |
PilzAdam |
bye |
| 22:25 |
kaeza |
bye Adam |
| 22:25 |
OldCoder |
kaeza, several IIRC |
| 22:25 |
|
jordan4ibanez joined #minetest |
| 22:26 |
kaeza |
now checking... |
| 22:26 |
kaeza |
OldCoder: can you recommend one? |
| 22:28 |
OldCoder |
kaeza, Octuworld was intended to be a battle world and has an arena |
| 22:28 |
OldCoder |
Right now the people build and don't fight |
| 22:28 |
OldCoder |
But drop in and ask them about the arena |
| 22:28 |
OldCoder |
world is 30004 |
| 22:28 |
OldCoder |
at minetest.org |
| 22:28 |
OldCoder |
Shut down for a while longer ATM |
| 22:28 |
OldCoder |
I am fixing corruption |
| 22:29 |
kaeza |
OldCoder: thank you |
| 22:29 |
OldCoder |
np |
| 22:32 |
kaeza |
Garp: http://minetest.net/forum/viewtopic.php?id=629 |
| 22:34 |
Garp |
kaeza: thanks. What is a "reasonable fast machine" ? |
| 22:34 |
kaeza |
IDK |
| 22:34 |
Garp |
WARNING: you need a reasonable fast machine with enough memory for animals. Minetest behaves REALLY bad if you hit the limits of your machine! GitHub Issue 229 |
| 22:34 |
kaeza |
I have an Intel E5700 Dual-Core @3.1 GHz(x2) |
| 22:35 |
Garp |
I'll try :) lets see |
| 22:37 |
Garp |
Well. I'm downloading some zip archive. I'll still have to see what to do with it |
| 22:37 |
|
milleja46 joined #minetest |
| 22:37 |
STHGOM |
bye |
| 22:40 |
Garp |
Adding animal creeper |
| 22:40 |
Garp |
Seems to do something |
| 22:40 |
|
opticlove joined #minetest |
| 22:41 |
Garp |
23:40:13: ACTION[ServerThread]: MOBF: BUG!!! didn't find a way to stop mob at(388.75,-23.00000038147,128.22668457031) from running into water or dropping |
| 22:41 |
kaeza |
that's common |
| 22:41 |
kaeza |
don't mind it |
| 22:42 |
kaeza |
oh and beware of big balls at night :) |
| 22:42 |
kaeza |
Ssssssssssssssss... KABOOOMM!!! |
| 22:43 |
Garp |
I got hit by stuff |
| 22:43 |
Garp |
Dont know what |
| 22:43 |
Garp |
oes it come from ground or above ? |
| 22:44 |
kaeza |
Garp: the balls? |
| 22:44 |
Garp |
the stuff. Id didnt saw what it was |
| 22:44 |
Garp |
just got red flashes |
| 22:45 |
kaeza |
they are meant to mimic these things: http://www.minecraftwiki.net/Creeper |
| 22:45 |
kaeza |
except they are big balls :) |
| 22:46 |
Garp |
I read... |
| 22:47 |
Garp |
top |
| 22:48 |
|
STHGOM joined #minetest |
| 22:48 |
Garp |
eat a lot of cpu ! |
| 22:49 |
kaeza |
unfortunately yes :( |
| 23:03 |
kaeza |
.sv |
| 23:03 |
kaeza |
ummm... |
| 23:03 |
STHGOM |
quiet |
| 23:04 |
kaeza |
oh |
| 23:04 |
STHGOM |
is zeg9 server off? |
| 23:05 |
kaeza |
dunno |
| 23:05 |
STHGOM |
i cant join |
| 23:06 |
STHGOM |
could we do voice chat? |
| 23:06 |
STHGOM |
not that i want to right now... |
| 23:07 |
kaeza |
Skype :) |
| 23:08 |
STHGOM |
lol |
| 23:08 |
STHGOM |
I don't have Skype |
| 23:08 |
OldCoder |
|
| 23:08 |
OldCoder |
All U.S. worlds are restarted |
| 23:08 |
OldCoder |
Please report problems. There are some important changes! |
| 23:09 |
NakedFury |
?? |
| 23:09 |
OldCoder |
More Flags has been updated. That is a minor one. |
| 23:09 |
OldCoder |
NakedFury, Mostly under the hood |
| 23:09 |
NakedFury |
what do you mean by flags? |
| 23:09 |
OldCoder |
NakedFury, I have an experiment fix for the player corruption problem |
| 23:09 |
OldCoder |
More Flags |
| 23:09 |
OldCoder |
is Dogzilla mod |
| 23:09 |
OldCoder |
That is a minor issue. Just a mod update. |
| 23:09 |
OldCoder |
* experimental |
| 23:09 |
NakedFury |
is it as simple as adding flags as in nation flags for looking nice or something else? |
| 23:10 |
kaeza |
OldCoder: I'm gonna test it |
| 23:10 |
OldCoder |
NakedFury, Adding nation flags to decorate |
| 23:10 |
OldCoder |
NakedFury, Not one of the "important changes" |
| 23:10 |
OldCoder |
kaeza, ty |
| 23:10 |
STHGOM |
zeg9 server is in france i think |
| 23:10 |
OldCoder |
STHGOM, No |
| 23:10 |
NakedFury |
ok |
| 23:10 |
OldCoder |
STHGOM, Zeg9 server is me now |
| 23:10 |
STHGOM |
ohh |
| 23:10 |
OldCoder |
Lots of Zeg9 changes today |
| 23:10 |
STHGOM |
you can call me sparky if you want to |
| 23:11 |
OldCoder |
Zeg9 players please report problems |
| 23:11 |
OldCoder |
O.K. sparky |
| 23:11 |
STHGOM |
thats who i am im minetest |
| 23:11 |
OldCoder |
k |
| 23:11 |
STHGOM |
STHGOM stands for: sparky the happy girrafe on minetest |
| 23:11 |
OldCoder |
STHGOM, yes I see you in Zegaton |
| 23:11 |
OldCoder |
Feel free to join other worlds here |
| 23:11 |
STHGOM |
is in on? |
| 23:11 |
OldCoder |
http://minetest.org/ |
| 23:11 |
OldCoder |
It is on now |
| 23:11 |
STHGOM |
minetest.org? |
| 23:12 |
OldCoder |
Yes |
| 23:12 |
OldCoder |
http://minetest.org/ has list |
| 23:12 |
STHGOM |
wow you type faaaaaaaaast |
| 23:12 |
OldCoder |
He is port 30015 |
| 23:12 |
OldCoder |
No slow |
| 23:12 |
OldCoder |
hand is injured |
| 23:12 |
OldCoder |
so very slow these days |
| 23:12 |
STHGOM |
zegs? |
| 23:12 |
STHGOM |
? |
| 23:13 |
kaeza |
anyone interested? https://github.com/kaeza/minetest-irc |
| 23:13 |
OldCoder |
R |
| 23:14 |
OldCoder |
Oh yes |
| 23:14 |
STHGOM |
ok I'm on minetest.org port 30015 |
| 23:14 |
STHGOM |
just to let everyone know... |
| 23:14 |
OldCoder |
STHGOM, Yep |
| 23:14 |
OldCoder |
kaeza, Very interested!! |
| 23:14 |
kaeza |
OldCoder: what is "R"? |
| 23:14 |
kaeza |
you keep saying that |
| 23:14 |
OldCoder |
R is for reading or reviewing |
| 23:14 |
kaeza |
ok sorry |
| 23:14 |
OldCoder |
Code looks useful |
| 23:15 |
OldCoder |
Shall we make mods and gateway the worlds to their own channels? |
| 23:15 |
kaeza |
join #minetest-irc-testing to see a demo |
| 23:15 |
OldCoder |
kaeza, Shall I start adding it? |
| 23:15 |
OldCoder |
How far has it been tested? |
| 23:16 |
OldCoder |
I wish to try this now |
| 23:16 |
OldCoder |
Proceeding |
| 23:17 |
kaeza |
the README may be a bit out of date |
| 23:18 |
OldCoder |
It is |
| 23:18 |
OldCoder |
Explain install and we will proceed right now |
| 23:19 |
OldCoder |
kaeza, ^ |
| 23:19 |
kaeza |
open up a cmd prompt/terminal |
| 23:19 |
OldCoder |
I have done cmake and make |
| 23:19 |
OldCoder |
What next? |
| 23:19 |
kaeza |
ok |
| 23:20 |
OldCoder |
I am familiar with builds :-) |
| 23:20 |
kaeza |
now ./packmod.sh or packmod.bat depending on os |
| 23:20 |
OldCoder |
Have done 10,000s of them |
| 23:20 |
OldCoder |
Error: Couldn't find luasocket lib. |
| 23:20 |
OldCoder |
Did you compile before running this script? |
| 23:20 |
kaeza |
you may have to chmod +x it |
| 23:20 |
OldCoder |
I did compile |
| 23:20 |
OldCoder |
The script? No |
| 23:20 |
OldCoder |
It works |
| 23:21 |
kaeza |
umm... that's strange |
| 23:21 |
kaeza |
KikaRz had the same problem |
| 23:21 |
OldCoder |
I will need to review further I guess |
| 23:22 |
kaeza |
see if there's a src/luasocket/luasocket.dll or so |
| 23:22 |
OldCoder |
.so |
| 23:22 |
OldCoder |
The script is wrong |
| 23:22 |
OldCoder |
Reviewing |
| 23:22 |
OldCoder |
Fixed it |
| 23:22 |
OldCoder |
Now what? |
| 23:23 |
OldCoder |
Copy irc folder to mods folder? |
| 23:23 |
OldCoder |
Where is channel specified? |
| 23:23 |
kaeza |
yes |
| 23:23 |
kaeza |
in init.lua |
| 23:23 |
OldCoder |
Where is channel specified? |
| 23:23 |
OldCoder |
k |
| 23:24 |
kaeza |
CHANNEL=... |
| 23:24 |
kaeza |
local CHANNEL = ... |
| 23:24 |
OldCoder |
Got it |
| 23:24 |
OldCoder |
Doc22, kaeza tell people on octuteam world I am restarting to add a fun feature |
| 23:25 |
kaeza |
I'm not in currently |
| 23:25 |
kaeza |
sorry |
| 23:25 |
OldCoder |
k |
| 23:26 |
kaeza |
OldCoder: https://dl.dropbox.com/u/100008207/screenshot_1489004061.jpg |
| 23:26 |
OldCoder |
R |
| 23:26 |
OldCoder |
Yep |
| 23:27 |
thexyz |
shaders are now in master, nice, before: http://i.imgur.com/GzThO.png, after: http://i.imgur.com/CBqtf.png |
| 23:27 |
kaeza |
thexyz: cool |
| 23:27 |
NakedFury |
very cool |
| 23:28 |
NakedFury |
going forward smoothly. after shaders is sun shadows |
| 23:29 |
STHGOM |
bye |
| 23:30 |
|
Dogzilla131 joined #minetest |
| 23:30 |
OldCoder |
kaeza, thx but not working in Octuteam world |
| 23:30 |
OldCoder |
Dogzilla131, hi |
| 23:30 |
kaeza |
hey Dogzilla131 |
| 23:31 |
OldCoder |
kaeza, I changed the channel and copied the irc folder into the mods folder |
| 23:31 |
OldCoder |
Restarted the world |
| 23:32 |
OldCoder |
Nothing happens with the mod |
| 23:32 |
OldCoder |
local CHANNEL = "##octuteam"; |
| 23:32 |
OldCoder |
I did that |
| 23:32 |
kaeza |
wait until it stops reading the MOTD |
| 23:32 |
OldCoder |
I did |
| 23:33 |
kaeza |
look if there is an "mt_game" user in "##octuteam" |
| 23:33 |
OldCoder |
k |
| 23:33 |
OldCoder |
Reentering |
| 23:33 |
OldCoder |
No |
| 23:33 |
kaeza |
hmmm |
| 23:33 |
kaeza |
wait |
| 23:33 |
OldCoder |
Client is not in world |
| 23:34 |
OldCoder |
minetest/games/octuteam_game/mods/irc |
| 23:34 |
OldCoder |
Mod folder is there |
| 23:34 |
OldCoder |
ftp.lua irc.lua LICENSE.txt smtp.lua |
| 23:34 |
OldCoder |
http.lua libluasocket.so ltn12.lua socket.lua |
| 23:34 |
OldCoder |
init.lua LICENSE-LuaIRC.txt mime.lua tp.lua |
| 23:34 |
OldCoder |
irc LICENSE-luasocket.txt README.txt url.lua |
| 23:34 |
OldCoder |
Those are contents of irc mod folder |
| 23:35 |
Dogzilla131 |
hi |
| 23:36 |
|
Uberi joined #minetest |
| 23:36 |
Dogzilla131 |
hey to you put sound in the game |
| 23:37 |
Dogzilla131 |
how |
| 23:39 |
Uberi |
simion314: hey |
| 23:39 |
simion314 |
Uberi: hi |
| 23:39 |
simion314 |
thx for the fix |
| 23:40 |
simion314 |
was this a regresion? it is strange this was not reported |
| 23:40 |
Uberi |
well not really |
| 23:40 |
Uberi |
frankly, the old behavior was far worse |
| 23:40 |
Uberi |
you could potentially crash the server with one of those things |
| 23:41 |
simion314 |
Uberi: do you mean with my build? it is comon to push piston with other pistons |
| 23:42 |
simion314 |
I am wondering why it updated properly if I cut then fix the wire, is other update function? |
| 23:42 |
Uberi |
simion314: yeah, there are a bunch of other places that can update it |
| 23:42 |
simion314 |
hard to maintain that |
| 23:43 |
Uberi |
indeed |
| 23:43 |
Uberi |
needs a refactor, in my opinion |
| 23:43 |
simion314 |
I imagine is hard to do the block updates, the order of updating seems important |
| 23:44 |
Uberi |
not too significant, there's a checked list that makes sure each node is on;y recalculated once |
| 23:44 |
simion314 |
I am new to lua, could it be posible to make the code more OOP? |
| 23:46 |
Uberi |
there isn't too much point to it, IMO |
| 23:47 |
Uberi |
the mesecon namespace is encapsulation enough, if you ask me |
| 23:47 |
simion314 |
Uberi: any idea if an ABBA switch can be program in the microcontroler? or I have to use the delayers? |
| 23:47 |
Uberi |
simion314: please elaborate |
| 23:47 |
Uberi |
a T-FF? |
| 23:48 |
simion314 |
not sure, turn A on then turn B on, then turn B off then A off |
| 23:48 |
simion314 |
it needs delays ,not sure if those can be programmed |
| 23:48 |
Uberi |
hmm, there are a few bugs with uc's after(), so you might need to use an external clock source and an internal state machine |
| 23:49 |
Uberi |
you can do it with two nodes though |
| 23:49 |
Uberi |
lemme give it a try |
| 23:51 |
jordan4ibanez |
Lol i created the quarry from buildcraft in minetest |
| 23:52 |
simion314 |
ABBa is used when you push a piston with other piston, first piston extends, then the second one and later you need second piston to pull first then the first one |
| 23:52 |
Uberi |
oh making a double piston extender? |
| 23:52 |
Uberi |
I have one in a 2x2 configuration |
| 23:52 |
simion314 |
I love making hidden dors and stuf like that with pistons but I hate that theis things requiere a lot of space and wires or redstone on the floor |
| 23:53 |
jordan4ibanez |
Idea: Wireless mesecons |
| 23:53 |
Uberi |
jordan4ibanez: v0.4 had them, but the mesecons rewrite broke it :( |
| 23:53 |
Uberi |
it's on my todo list right now |
| 23:53 |
jordan4ibanez |
Use signs to make them, like the bukkit mod |
| 23:55 |
|
STHGOM joined #minetest |
| 23:55 |
Uberi |
simion314: http://www.pasteall.org/37687 |
| 23:55 |
STHGOM |
hallooo |
| 23:55 |
Uberi |
hey STHGOM |
| 23:56 |
kaeza |
simion314: try this: on(A)on(B)if(C)off(B)off(A) |
| 23:56 |
kaeza |
then connect either A or B to a delayer or a micro with after() |
| 23:56 |
Uberi |
kaeza: nah, that needs delays to work |
| 23:56 |
kaeza |
and make it connect to C |
| 23:56 |
Uberi |
kaeza: the schematic I pasted above does that :P |
| 23:57 |
Uberi |
except it has some additional logic to make sure it correctly pulls the last node |
| 23:57 |
|
erick joined #minetest |
| 23:59 |
|
kaeza1 joined #minetest |
